Difference between revisions of "L-1-GLYCEROPHOSPHORYLETHANOL-AMINE"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8890 CPD-8890] == * smiles: ** C(=[N+]1(C(C([O-])=O)CC2(C1=CC(=O)C(=O)C=2)))C=C3(C=C(C(=O)[...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN0-276 RXN0-276] == * direction: ** REVERSIBLE * ec number: ** [http://enzyme.expasy.org/EC/1 EC-...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8890 CPD-8890] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN0-276 RXN0-276] ==
−
* smiles:
+
* direction:
−
** C(=[N+]1(C(C([O-])=O)CC2(C1=CC(=O)C(=O)C=2)))C=C3(C=C(C(=O)[O-])NC(C([O-])=O)C3)
+
** REVERSIBLE
−
* inchi key:
+
* ec number:
−
** InChIKey=MCTHLMSFLMEBEK-AAEUAGOBSA-L
+
** [http://enzyme.expasy.org/EC/1 EC-1]
−
* common name:
+
−
** betanidin quinone
+
−
* molecular weight:
+
−
** 384.301   
+
 
* Synonym(s):
 
* Synonym(s):
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
== Reaction(s) known to produce the compound ==
+
* With identifiers:
−
* [[RXN-8635]]
+
** 1 [[S-HYDROXYMETHYLGLUTATHIONE]][c] '''+''' 1 [[NAD]][c] '''<=>''' 1 [[NADH]][c] '''+''' 1 [[PROTON]][c] '''+''' 1 [[CPD-548]][c]
−
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 1 S-hydroxymethylglutathione[c] '''+''' 1 NAD+[c] '''<=>''' 1 NADH[c] '''+''' 1 H+[c] '''+''' 1 S-formylglutathione[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Ec-16_001960]]
 +
** Source: [[orthology-aragem]]
 +
== Pathways  ==
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-aragem]]
 +
*** Tool: [[pantograph]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: direction=REVERSIBLE}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25246300 25246300]
+
{{#set: ec number=EC-1}}
−
{{#set: smiles=C(=[N+]1(C(C([O-])=O)CC2(C1=CC(=O)C(=O)C=2)))C=C3(C=C(C(=O)[O-])NC(C([O-])=O)C3)}}
+
{{#set: gene associated=Ec-16_001960}}
−
{{#set: inchi key=InChIKey=MCTHLMSFLMEBEK-AAEUAGOBSA-L}}
+
{{#set: in pathway=}}
−
{{#set: common name=betanidin quinone}}
+
{{#set: reconstruction category=orthology}}
−
{{#set: molecular weight=384.301    }}
+
{{#set: reconstruction source=orthology-aragem}}
−
{{#set: produced by=RXN-8635}}
+
{{#set: reconstruction tool=pantograph}}

Revision as of 13:31, 21 March 2018

Reaction RXN0-276

  • direction:
    • REVERSIBLE
  • ec number:
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

Reconstruction information

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=L-1-GLYCEROPHOSPHORYLETHANOL-AMINE&oldid=19327"