Difference between revisions of "CPD-1103"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13912 CPD-13912] == * smiles: ** C(C(C(O)C(C([O-])=O)(C([O-])=O)O)O)O * inchi key: ** InChI...")
(Created page with "Category:Gene == Gene Ec-00_003690 == * left end position: ** 3944147 * transcription direction: ** POSITIVE * right end position: ** 3950674 * centisome position: ** 20.8...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13912 CPD-13912] ==
+
== Gene Ec-00_003690 ==
−
* smiles:
+
* left end position:
−
** C(C(C(O)C(C([O-])=O)(C([O-])=O)O)O)O
+
** 3944147
−
* inchi key:
+
* transcription direction:
−
** InChIKey=CQIRJDZGDXTXKF-UHFFFAOYSA-L
+
** POSITIVE
−
* common name:
+
* right end position:
−
** 2-carboxy-L-threo-pentonate
+
** 3950674
−
* molecular weight:
+
* centisome position:
−
** 208.124    
+
** 20.81736    
 
* Synonym(s):
 
* Synonym(s):
−
** 2-carboxy-L-xylonate
+
** Esi_0235_0029
−
** 2-hydroxy-2-(1,2,3-trihydroxypropyl)propanedioate
+
** Esi0235_0029
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
== Reaction(s) known to produce the compound ==
+
* Reaction: [[CARBOXYPEPTIDASE-A-RXN]]
−
* [[RXN-12871]]
+
** Source: [[annotation-esiliculosus_genome]]
−
== Reaction(s) of unknown directionality ==
+
*** Assignment: go-term
 +
== Pathways associated ==
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: left end position=3944147}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90657336 90657336]
+
{{#set: transcription direction=POSITIVE}}
−
{{#set: smiles=C(C(C(O)C(C([O-])=O)(C([O-])=O)O)O)O}}
+
{{#set: right end position=3950674}}
−
{{#set: inchi key=InChIKey=CQIRJDZGDXTXKF-UHFFFAOYSA-L}}
+
{{#set: centisome position=20.81736   }}
−
{{#set: common name=2-carboxy-L-threo-pentonate}}
+
{{#set: common name=Esi_0235_0029|Esi0235_0029}}
−
{{#set: molecular weight=208.124   }}
+
{{#set: reaction associated=CARBOXYPEPTIDASE-A-RXN}}
−
{{#set: common name=2-carboxy-L-xylonate|2-hydroxy-2-(1,2,3-trihydroxypropyl)propanedioate}}
+
−
{{#set: produced by=RXN-12871}}
+

Revision as of 14:31, 21 March 2018

Gene Ec-00_003690

  • left end position:
    • 3944147
  • transcription direction:
    • POSITIVE
  • right end position:
    • 3950674
  • centisome position:
    • 20.81736
  • Synonym(s):
    • Esi_0235_0029
    • Esi0235_0029

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=CPD-1103&oldid=19367"