Difference between revisions of "Ec-28 000420"
From metabolic_network
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6369 PWY-6369] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2759 TAX-27...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GAMMA-LINOLENOYL-COA GAMMA-LINOLENOYL-COA] == * smiles: ** CCCCCC=CCC=CCC=CCCCCC(=O)SCCNC(=O)CC...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GAMMA-LINOLENOYL-COA GAMMA-LINOLENOYL-COA] == |
| − | * | + | * smiles: |
| − | ** [ | + | ** CCCCCC=CCC=CCC=CCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-] |
| + | * inchi key: | ||
| + | ** InChIKey=XZQYPTBYQYZGRU-FHDVEODPSA-J | ||
* common name: | * common name: | ||
| − | ** | + | ** γ-linolenoyl-CoA |
| + | * molecular weight: | ||
| + | ** 1023.921 | ||
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** (6Z,9Z,12Z)-octadeca-6,9,12-trienoyl-CoA |
| + | ** (6Z,9Z,12Z)-octadecatrienoyl-CoA | ||
| − | == Reaction(s) | + | == Reaction(s) known to consume the compound == |
| − | + | == Reaction(s) known to produce the compound == | |
| − | + | * [[1.14.19.3-RXN]] | |
| − | + | * [[RXN-16043]] | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | == Reaction(s) | + | |
| − | * [ | + | |
| − | + | ||
| − | * [ | + | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
== External links == | == External links == | ||
| − | {{#set: | + | * LIGAND-CPD: |
| − | {{#set: | + | ** [http://www.genome.jp/dbget-bin/www_bget?C03035 C03035] |
| − | {{#set: common name= | + | * CHEBI: |
| − | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57363 57363] |
| − | {{#set: | + | * METABOLIGHTS : MTBLC57363 |
| − | {{#set: | + | * PUBCHEM: |
| + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=45266591 45266591] | ||
| + | * HMDB : HMDB06368 | ||
| + | {{#set: smiles=CCCCCC=CCC=CCC=CCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}} | ||
| + | {{#set: inchi key=InChIKey=XZQYPTBYQYZGRU-FHDVEODPSA-J}} | ||
| + | {{#set: common name=γ-linolenoyl-CoA}} | ||
| + | {{#set: molecular weight=1023.921 }} | ||
| + | {{#set: common name=(6Z,9Z,12Z)-octadeca-6,9,12-trienoyl-CoA|(6Z,9Z,12Z)-octadecatrienoyl-CoA}} | ||
| + | {{#set: produced by=1.14.19.3-RXN|RXN-16043}} | ||
Revision as of 14:33, 21 March 2018
Contents
Metabolite GAMMA-LINOLENOYL-COA
- smiles:
- CCCCCC=CCC=CCC=CCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
- inchi key:
- InChIKey=XZQYPTBYQYZGRU-FHDVEODPSA-J
- common name:
- γ-linolenoyl-CoA
- molecular weight:
- 1023.921
- Synonym(s):
- (6Z,9Z,12Z)-octadeca-6,9,12-trienoyl-CoA
- (6Z,9Z,12Z)-octadecatrienoyl-CoA
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CCCCCC=CCC=CCC=CCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-" cannot be used as a page name in this wiki.
