Difference between revisions of "ACETYLORNTRANSAM-RXN"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GALACTOSE-1P GALACTOSE-1P] == * smiles: ** C(O)C1(OC(OP(=O)([O-])[O-])C(O)C(O)C(O)1) * inchi ke...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-11881 RXN-11881] == * direction: ** LEFT-TO-RIGHT * common name: ** 4α,14α-dimethyl...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Reaction]] |
| − | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-11881 RXN-11881] == |
| − | * | + | * direction: |
| − | ** | + | ** LEFT-TO-RIGHT |
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** α- | + | ** 4α,14α-dimethyl-5α-cholesta-8,24-dien-3β-ol 14-demethylase |
| − | * | + | ** Cytochrome P450 |
| − | ** | + | * ec number: |
| + | ** [http://enzyme.expasy.org/EC/1.14.13.70 EC-1.14.13.70] | ||
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | |||
| − | |||
| − | |||
| − | == Reaction(s) | + | == Reaction Formula == |
| − | == | + | * With identifiers: |
| − | == | + | ** 1 [[CPD-12852]][c] '''+''' 3 [[NADPH]][c] '''+''' 2 [[PROTON]][c] '''+''' 3 [[OXYGEN-MOLECULE]][c] '''=>''' 1 [[FORMATE]][c] '''+''' 1 [[CPD-12853]][c] '''+''' 4 [[WATER]][c] '''+''' 3 [[NADP]][c] |
| − | * [[ | + | * With common name(s): |
| − | * [[ | + | ** 1 4α,14α-dimethyl-5α-cholesta-8,24-dien-3β-ol[c] '''+''' 3 NADPH[c] '''+''' 2 H+[c] '''+''' 3 oxygen[c] '''=>''' 1 formate[c] '''+''' 1 4α-methyl-5α-cholesta-8,14,24-trien-3β-ol[c] '''+''' 4 H2O[c] '''+''' 3 NADP+[c] |
| + | |||
| + | == Genes associated with this reaction == | ||
| + | Genes have been associated with this reaction based on different elements listed below. | ||
| + | * Gene: [[Ec-10_006240]] | ||
| + | ** Source: [[annotation-esiliculosus_genome]] | ||
| + | *** Assignment: EC-NUMBER | ||
| + | == Pathways == | ||
| + | == Reconstruction information == | ||
| + | * Category: [[annotation]] | ||
| + | ** Source: [[annotation-esiliculosus_genome]] | ||
| + | *** Tool: [[pathwaytools]] | ||
== External links == | == External links == | ||
| − | + | {{#set: direction=LEFT-TO-RIGHT}} | |
| − | + | {{#set: common name=4α,14α-dimethyl-5α-cholesta-8,24-dien-3β-ol 14-demethylase}} | |
| − | + | {{#set: common name=Cytochrome P450}} | |
| − | + | {{#set: ec number=EC-1.14.13.70}} | |
| − | + | {{#set: gene associated=Ec-10_006240}} | |
| − | + | {{#set: in pathway=}} | |
| − | + | {{#set: reconstruction category=annotation}} | |
| − | + | {{#set: reconstruction source=annotation-esiliculosus_genome}} | |
| − | + | {{#set: reconstruction tool=pathwaytools}} | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
Revision as of 13:34, 21 March 2018
Contents
Reaction RXN-11881
- direction:
- LEFT-TO-RIGHT
- common name:
- 4α,14α-dimethyl-5α-cholesta-8,24-dien-3β-ol 14-demethylase
- Cytochrome P450
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- With common name(s):
- 1 4α,14α-dimethyl-5α-cholesta-8,24-dien-3β-ol[c] + 3 NADPH[c] + 2 H+[c] + 3 oxygen[c] => 1 formate[c] + 1 4α-methyl-5α-cholesta-8,14,24-trien-3β-ol[c] + 4 H2O[c] + 3 NADP+[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Ec-10_006240
- Source: annotation-esiliculosus_genome
- Assignment: EC-NUMBER
- Source: annotation-esiliculosus_genome
Pathways
Reconstruction information
- Category: annotation
- Source: annotation-esiliculosus_genome
- Tool: pathwaytools
- Source: annotation-esiliculosus_genome
