Difference between revisions of "CPD-10267"

Revision as of 13:34, 21 March 2018

"C(O)C1(OC(=O)C(=O)OC(C(=O)[O-])1)" cannot be used as a page name in this wiki.

@@ Line 1: / Line 1: @@
-[[Category:Gene]]
+[[Category:Metabolite]]
-== Gene Ec-25_000050 ==
+== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13914 CPD-13914] ==
+* smiles:
+** C(O)C1(OC(=O)C(=O)OC(C(=O)[O-])1)
+* inchi key:
+** InChIKey=NKBSFRFTBUHMJF-UHFFFAOYSA-M
+* common name:
+** cyclic-2,3-O-oxalyl-L-threonate
+* molecular weight:
+** 189.101
 * Synonym(s):
-** Esi_0322_0008
+** 2,3-cyclic oxalyl theronolactone
-** Esi0322_0008
-== Reactions associated ==
+== Reaction(s) known to consume the compound ==
-* [[RXN-8443]]
+* [[RXN-12872]]
-** [[pantograph]]-[[aragem]]
+== Reaction(s) known to produce the compound ==
-== Pathways associated ==
+* [[RXN-12869]]
-* [[PWY-5381]]
+== Reaction(s) of unknown directionality ==
 == External links  ==
-{{#set: common name=Esi_0322_0008|Esi0322_0008}}
+* PUBCHEM:
-{{#set: reaction associated=RXN-8443}}
+** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90659383 90659383]
-{{#set: pathway associated=PWY-5381}}
+{{#set: smiles=C(O)C1(OC(=O)C(=O)OC(C(=O)[O-])1)}}
+{{#set: inchi key=InChIKey=NKBSFRFTBUHMJF-UHFFFAOYSA-M}}
+{{#set: common name=cyclic-2,3-O-oxalyl-L-threonate}}
+{{#set: molecular weight=189.101    }}
+{{#set: common name=2,3-cyclic oxalyl theronolactone}}
+{{#set: consumed by=RXN-12872}}
+{{#set: produced by=RXN-12869}}