Difference between revisions of "RXN-16044"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14276 CPD-14276] == * smiles: ** CCCCCCCCCCCCCCCCCCCC(O)CC(=O)SCCNC(=O)CCNC(C(O)C(C)(C)COP(...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GALACTOSE-1P GALACTOSE-1P] == * smiles: ** C(O)C1(OC(OP(=O)([O-])[O-])C(O)C(O)C(O)1) * inchi ke...") |
||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GALACTOSE-1P GALACTOSE-1P] == |
* smiles: | * smiles: | ||
| − | ** | + | ** C(O)C1(OC(OP(=O)([O-])[O-])C(O)C(O)C(O)1) |
| − | + | ||
| − | + | ||
* inchi key: | * inchi key: | ||
| − | ** InChIKey= | + | ** InChIKey=HXXFSFRBOHSIMQ-FPRJBGLDSA-L |
| + | * common name: | ||
| + | ** α-D-galactose 1-phosphate | ||
* molecular weight: | * molecular weight: | ||
| − | ** | + | ** 258.121 |
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** α-D-Gal-1-P |
| + | ** α-D-galactopyranose 1-phosphate | ||
| + | ** galactose-1-P | ||
| + | ** D-galactose-1-phosphate | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| + | * [[GALACTURIDYLYLTRANS-RXN]] | ||
| + | * [[GALACTOKIN-RXN]] | ||
== External links == | == External links == | ||
| + | * CAS : 2255-14-3 | ||
| + | * BIGG : 35001 | ||
* PUBCHEM: | * PUBCHEM: | ||
| − | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=7098639 7098639] |
| + | * HMDB : HMDB00645 | ||
| + | * LIGAND-CPD: | ||
| + | ** [http://www.genome.jp/dbget-bin/www_bget?C00446 C00446] | ||
| + | * CHEMSPIDER: | ||
| + | ** [http://www.chemspider.com/Chemical-Structure.5447153.html 5447153] | ||
* CHEBI: | * CHEBI: | ||
| − | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58336 58336] |
| − | {{#set: smiles= | + | * METABOLIGHTS : MTBLC58336 |
| − | {{#set: | + | {{#set: smiles=C(O)C1(OC(OP(=O)([O-])[O-])C(O)C(O)C(O)1)}} |
| − | {{#set: | + | {{#set: inchi key=InChIKey=HXXFSFRBOHSIMQ-FPRJBGLDSA-L}} |
| − | {{#set: molecular weight= | + | {{#set: common name=α-D-galactose 1-phosphate}} |
| − | {{#set: common name= | + | {{#set: molecular weight=258.121 }} |
| − | {{#set: | + | {{#set: common name=α-D-Gal-1-P|α-D-galactopyranose 1-phosphate|galactose-1-P|D-galactose-1-phosphate}} |
| − | + | {{#set: reversible reaction associated=GALACTURIDYLYLTRANS-RXN|GALACTOKIN-RXN}} | |
Revision as of 13:34, 21 March 2018
Contents
Metabolite GALACTOSE-1P
- smiles:
- C(O)C1(OC(OP(=O)([O-])[O-])C(O)C(O)C(O)1)
- inchi key:
- InChIKey=HXXFSFRBOHSIMQ-FPRJBGLDSA-L
- common name:
- α-D-galactose 1-phosphate
- molecular weight:
- 258.121
- Synonym(s):
- α-D-Gal-1-P
- α-D-galactopyranose 1-phosphate
- galactose-1-P
- D-galactose-1-phosphate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- CAS : 2255-14-3
- BIGG : 35001
- PUBCHEM:
- HMDB : HMDB00645
- LIGAND-CPD:
- CHEMSPIDER:
- CHEBI:
- METABOLIGHTS : MTBLC58336
"C(O)C1(OC(OP(=O)([O-])[O-])C(O)C(O)C(O)1)" cannot be used as a page name in this wiki.
