Difference between revisions of "PWY-0"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GUANINE GUANINE] == * smiles: ** C2(=NC1(=C(N=C(NC(=O)1)N)N2)) * inchi key: ** InChIKey=UYTPUPD...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=ARG-PRO-PWY ARG-PRO-PWY] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33090...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Pathway]] |
| − | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=ARG-PRO-PWY ARG-PRO-PWY] == |
| − | * | + | * taxonomic range: |
| − | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33090 TAX-33090] |
| − | * | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-1117 TAX-1117] |
| − | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-4751 TAX-4751] |
* common name: | * common name: | ||
| − | ** | + | ** L-arginine degradation VI (arginase 2 pathway) |
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| + | ** L-proline biosynthesis from arginine | ||
| − | == Reaction(s) | + | == Reaction(s) found == |
| − | + | '''4''' reactions found over '''4''' reactions in the full pathway | |
| − | * [[ | + | * [[ARGINASE-RXN]] |
| − | * [[ | + | ** 2 associated gene(s): |
| − | + | *** [[Ec-10_001100]] | |
| − | * [[ | + | *** [[Ec-22_003700]] |
| − | * [[ | + | ** 2 reconstruction source(s) associated: |
| + | *** [[annotation-esiliculosus_genome]] | ||
| + | *** [[orthology-aragem]] | ||
| + | * [[ORNITHINE-GLU-AMINOTRANSFERASE-RXN]] | ||
| + | ** 1 associated gene(s): | ||
| + | *** [[Ec-21_003730]] | ||
| + | ** 1 reconstruction source(s) associated: | ||
| + | *** [[annotation-esiliculosus_genome]] | ||
| + | * [[PYRROLINECARBREDUCT-RXN]] | ||
| + | ** 5 associated gene(s): | ||
| + | *** [[Ec-07_007350]] | ||
| + | *** [[Ec-07_007360]] | ||
| + | *** [[Ec-07_007340]] | ||
| + | *** [[Ec-05_006410]] | ||
| + | *** [[Ec-03_004680]] | ||
| + | ** 1 reconstruction source(s) associated: | ||
| + | *** [[annotation-esiliculosus_genome]] | ||
| + | * [[SPONTPRO-RXN]] | ||
| + | ** 0 associated gene: | ||
| + | ** 1 reconstruction source(s) associated: | ||
| + | *** [[annotation-esiliculosus_genome]] | ||
| + | == Reaction(s) not found == | ||
== External links == | == External links == | ||
| − | + | {{#set: taxonomic range=TAX-33090}} | |
| − | + | {{#set: taxonomic range=TAX-1117}} | |
| − | + | {{#set: taxonomic range=TAX-4751}} | |
| − | + | {{#set: common name=L-arginine degradation VI (arginase 2 pathway)}} | |
| − | + | {{#set: common name=L-proline biosynthesis from arginine}} | |
| − | + | {{#set: reaction found=4}} | |
| − | + | {{#set: total reaction=4}} | |
| − | + | {{#set: completion rate=100.0}} | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: common name= | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
Revision as of 13:34, 21 March 2018
Pathway ARG-PRO-PWY
- taxonomic range:
- common name:
- L-arginine degradation VI (arginase 2 pathway)
- Synonym(s):
- L-proline biosynthesis from arginine
Reaction(s) found
4 reactions found over 4 reactions in the full pathway
- ARGINASE-RXN
- 2 associated gene(s):
- 2 reconstruction source(s) associated:
- ORNITHINE-GLU-AMINOTRANSFERASE-RXN
- 1 associated gene(s):
- 1 reconstruction source(s) associated:
- PYRROLINECARBREDUCT-RXN
- 5 associated gene(s):
- 1 reconstruction source(s) associated:
- SPONTPRO-RXN
- 0 associated gene:
- 1 reconstruction source(s) associated:
