Difference between revisions of "Saturated-Fatty-Acyl-ACPs"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-5641 RXN-5641] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/EC/4....")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7015 CPD-7015] == * smiles: ** C=CC2(C(C)=C4(C=C9(C(C)C(CCC(=O)[O-])C5(=N([Mg]36(N1(=C(C(CC...")
Line 1: Line 1:
[[Category:Reaction]]
+
[[Category:Metabolite]]
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-5641 RXN-5641] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7015 CPD-7015] ==
* direction:
+
* smiles:
** LEFT-TO-RIGHT
+
** C=CC2(C(C)=C4(C=C9(C(C)C(CCC(=O)[O-])C5(=N([Mg]36(N1(=C(C(CC)=C(CO)C1=CC=2N34)C=C7(C(C)=C8(C(=O)[C-](C(OC)=O)C5=C(N67)8)))))9))))
* ec number:
+
* common name:
** [http://enzyme.expasy.org/EC/4.1.1 EC-4.1.1]
+
** 71-hydroxychlorophyllide a
 +
* molecular weight:
 +
** 628.966   
 
* Synonym(s):
 
* Synonym(s):
 +
** 7-hydroxychlorophyllide a (misleading)
  
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
* With identifiers:
+
* [[RXN-7677]]
** 1 [[PROTON]][c] '''+''' 1 [[SER]][c] '''=>''' 1 [[ETHANOL-AMINE]][c] '''+''' 1 [[CARBON-DIOXIDE]][c]
+
== Reaction(s) known to produce the compound ==
* With common name(s):
+
* [[RXN-7676]]
** 1 H+[c] '''+''' 1 L-serine[c] '''=>''' 1 ethanolamine[c] '''+''' 1 CO2[c]
+
== Reaction(s) of unknown directionality ==
 
+
== Genes associated with this reaction  ==
+
== Pathways  ==
+
* [[PWY-7782]], plasmalogen biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7782 PWY-7782]
+
** '''6''' reactions found over '''16''' reactions in the full pathway
+
* [[PWY4FS-6]], phosphatidylethanolamine biosynthesis II: [http://metacyc.org/META/NEW-IMAGE?object=PWY4FS-6 PWY4FS-6]
+
** '''4''' reactions found over '''4''' reactions in the full pathway
+
* [[PWY-3385]], choline biosynthesis I: [http://metacyc.org/META/NEW-IMAGE?object=PWY-3385 PWY-3385]
+
** '''2''' reactions found over '''6''' reactions in the full pathway
+
== Reconstruction information  ==
+
* Category: [[annotation]]
+
** Source: [[annotation-esiliculosus_genome]]
+
*** Tool: [[pathwaytools]]
+
 
== External links  ==
 
== External links  ==
{{#set: direction=LEFT-TO-RIGHT}}
+
* PUBCHEM:
{{#set: ec number=EC-4.1.1}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90657206 90657206]
{{#set: in pathway=PWY-7782|PWY4FS-6|PWY-3385}}
+
* LIGAND-CPD:
{{#set: reconstruction category=annotation}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C16540 C16540]
{{#set: reconstruction source=annotation-esiliculosus_genome}}
+
{{#set: smiles=C=CC2(C(C)=C4(C=C9(C(C)C(CCC(=O)[O-])C5(=N([Mg]36(N1(=C(C(CC)=C(CO)C1=CC=2N34)C=C7(C(C)=C8(C(=O)[C-](C(OC)=O)C5=C(N67)8)))))9))))}}
{{#set: reconstruction tool=pathwaytools}}
+
{{#set: common name=71-hydroxychlorophyllide a}}
 +
{{#set: molecular weight=628.966    }}
 +
{{#set: common name=7-hydroxychlorophyllide a (misleading)}}
 +
{{#set: consumed by=RXN-7677}}
 +
{{#set: produced by=RXN-7676}}

Revision as of 13:35, 21 March 2018

Metabolite CPD-7015

  • smiles:
    • C=CC2(C(C)=C4(C=C9(C(C)C(CCC(=O)[O-])C5(=N([Mg]36(N1(=C(C(CC)=C(CO)C1=CC=2N34)C=C7(C(C)=C8(C(=O)[C-](C(OC)=O)C5=C(N67)8)))))9))))
  • common name:
    • 71-hydroxychlorophyllide a
  • molecular weight:
    • 628.966
  • Synonym(s):
    • 7-hydroxychlorophyllide a (misleading)

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C=CC2(C(C)=C4(C=C9(C(C)C(CCC(=O)[O-])C5(=N([Mg]36(N1(=C(C(CC)=C(CO)C1=CC=2N34)C=C7(C(C)=C8(C(=O)[C-](C(OC)=O)C5=C(N67)8)))))9))))" cannot be used as a page name in this wiki.