Difference between revisions of "PWY-5035"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CDP CDP] == * smiles: ** C(C2(C(C(C(N1(C(N=C(C=C1)N)=O))O2)O)O))OP(OP([O-])([O-])=O)([O-])=O *...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-16103 RXN-16103] == * direction: ** REVERSIBLE * ec number: ** [http://enzyme.expasy.org/EC/2.3...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Reaction]] |
| − | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-16103 RXN-16103] == |
| − | + | * direction: | |
| − | + | ** REVERSIBLE | |
| − | * | + | * ec number: |
| − | ** | + | ** [http://enzyme.expasy.org/EC/2.3.1 EC-2.3.1] |
| − | * | + | |
| − | ** | + | |
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | |||
| − | == Reaction | + | == Reaction Formula == |
| − | * [[ | + | * With identifiers: |
| − | + | ** 1 [[CPD-17312]][c] '''+''' 1 [[Glycerolipids]][c] '''<=>''' 1 [[CO-A]][c] '''+''' 1 [[CPD-17355]][c] | |
| − | + | * With common name(s): | |
| − | * [[ | + | ** 1 docosahexaenoyl-CoA[c] '''+''' 1 a glycerolipid[c] '''<=>''' 1 coenzyme A[c] '''+''' 1 a [glycerolipid]-docosahexaenoate[c] |
| − | == | + | |
| − | * [[ | + | == Genes associated with this reaction == |
| − | * [[ | + | == Pathways == |
| − | * [[ | + | * [[PWY-7606]], docosahexaenoate biosynthesis III (6-desaturase, mammals): [http://metacyc.org/META/NEW-IMAGE?object=PWY-7606 PWY-7606] |
| − | * [[ | + | ** '''14''' reactions found over '''14''' reactions in the full pathway |
| − | + | * [[PWY-7727]], docosahexaenoate biosynthesis IV (4-desaturase, mammals): [http://metacyc.org/META/NEW-IMAGE?object=PWY-7727 PWY-7727] | |
| + | ** '''5''' reactions found over '''6''' reactions in the full pathway | ||
| + | == Reconstruction information == | ||
| + | * Category: [[annotation]] | ||
| + | ** Source: [[annotation-esiliculosus_genome]] | ||
| + | *** Tool: [[pathwaytools]] | ||
== External links == | == External links == | ||
| − | + | {{#set: direction=REVERSIBLE}} | |
| − | + | {{#set: ec number=EC-2.3.1}} | |
| − | + | {{#set: in pathway=PWY-7606|PWY-7727}} | |
| − | + | {{#set: reconstruction category=annotation}} | |
| − | + | {{#set: reconstruction source=annotation-esiliculosus_genome}} | |
| − | + | {{#set: reconstruction tool=pathwaytools}} | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | + | ||
Revision as of 13:35, 21 March 2018
Contents
Reaction RXN-16103
- direction:
- REVERSIBLE
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 CPD-17312[c] + 1 Glycerolipids[c] <=> 1 CO-A[c] + 1 CPD-17355[c]
- With common name(s):
- 1 docosahexaenoyl-CoA[c] + 1 a glycerolipid[c] <=> 1 coenzyme A[c] + 1 a [glycerolipid]-docosahexaenoate[c]
Genes associated with this reaction
Pathways
- PWY-7606, docosahexaenoate biosynthesis III (6-desaturase, mammals): PWY-7606
- 14 reactions found over 14 reactions in the full pathway
- PWY-7727, docosahexaenoate biosynthesis IV (4-desaturase, mammals): PWY-7727
- 5 reactions found over 6 reactions in the full pathway
Reconstruction information
- Category: annotation
- Source: annotation-esiliculosus_genome
- Tool: pathwaytools
- Source: annotation-esiliculosus_genome
