Difference between revisions of "3.4.11.2-RXN"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9852 CPD-9852] == * smiles: ** CC(C)=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCC1(=C(O)C=CC(C(=...")
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5754 PWY-5754] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2759 TAX-27...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Pathway]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9852 CPD-9852] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5754 PWY-5754] ==
−
* smiles:
+
* taxonomic range:
−
** CC(C)=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCC1(=C(O)C=CC(C(=O)[O-])=C1))C)C)C)C)C)C
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2759 TAX-2759]
−
* inchi key:
+
−
** InChIKey=PEMFGDIFKKXFRG-PYHSYOTJSA-M
+
 
* common name:
 
* common name:
−
** 3-heptaprenyl-4-hydroxybenzoate
+
** 4-hydroxybenzoate biosynthesis I (eukaryotes)
−
* molecular weight:
+
−
** 613.942   
+
 
* Synonym(s):
 
* Synonym(s):
 +
** p-hydroxybenzoate biosynthesis I (eukaryotes)
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
−
== Reaction(s) known to produce the compound ==
+
'''2''' reactions found over '''6''' reactions in the full pathway
−
* [[RXN-9222]]
+
* [[4-COUMARATE--COA-LIGASE-RXN]]
−
== Reaction(s) of unknown directionality ==
+
** 2 associated gene(s):
 +
*** [[Ec-10_001480]]
 +
*** [[Ec-04_001280]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[orthology-aragem]]
 +
* [[TYROSINE-AMINOTRANSFERASE-RXN]]
 +
** 0 associated gene:
 +
** 1 reconstruction source(s) associated:
 +
*** [[gap-filling-gapfilling_solution_with_meneco_draft_medium]]
 +
== Reaction(s) not found ==
 +
* [http://metacyc.org/META/NEW-IMAGE?object=3.1.2.23-RXN 3.1.2.23-RXN]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=HYDROXYPHENYLPYRUVATE-REDUCTASE-RXN HYDROXYPHENYLPYRUVATE-REDUCTASE-RXN]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN3O-1118 RXN3O-1118]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN3O-1120 RXN3O-1120]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: taxonomic range=TAX-2759}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=54740346 54740346]
+
{{#set: common name=4-hydroxybenzoate biosynthesis I (eukaryotes)}}
−
* CHEBI:
+
{{#set: common name=p-hydroxybenzoate biosynthesis I (eukaryotes)}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=84496 84496]
+
{{#set: reaction found=2}}
−
{{#set: smiles=CC(C)=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCC1(=C(O)C=CC(C(=O)[O-])=C1))C)C)C)C)C)C}}
+
{{#set: total reaction=6}}
−
{{#set: inchi key=InChIKey=PEMFGDIFKKXFRG-PYHSYOTJSA-M}}
+
{{#set: completion rate=33.0}}
−
{{#set: common name=3-heptaprenyl-4-hydroxybenzoate}}
+
−
{{#set: molecular weight=613.942    }}
+
−
{{#set: produced by=RXN-9222}}
+

Revision as of 13:36, 21 March 2018

Pathway PWY-5754

  • taxonomic range:
  • common name:
    • 4-hydroxybenzoate biosynthesis I (eukaryotes)
  • Synonym(s):
    • p-hydroxybenzoate biosynthesis I (eukaryotes)

Reaction(s) found

2 reactions found over 6 reactions in the full pathway

Reaction(s) not found

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=3.4.11.2-RXN&oldid=20063"