Difference between revisions of "D-MYO-INOSITOL-1-MONOPHOSPHATE"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=P184-PWY P184-PWY] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-1224 TAX-12...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11281 CPD-11281] == * smiles: ** C(SS)C(C(NCC([O-])=O)=O)NC(=O)CCC([N+])C([O-])=O * inchi k...")
Line 1: Line 1:
−
[[Category:Pathway]]
+
[[Category:Metabolite]]
−
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=P184-PWY P184-PWY] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11281 CPD-11281] ==
−
* taxonomic range:
+
* smiles:
−
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-1224 TAX-1224]
+
** C(SS)C(C(NCC([O-])=O)=O)NC(=O)CCC([N+])C([O-])=O
 +
* inchi key:
 +
** InChIKey=QBOLVLBSUGJHGB-WDSKDSINSA-M
 
* common name:
 
* common name:
−
** protocatechuate degradation I (meta-cleavage pathway)
+
** S-sulfanylglutathione
 +
* molecular weight:
 +
** 338.373   
 
* Synonym(s):
 
* Synonym(s):
−
** protocatechuate degradation via meta-cleavage
+
** GSSH
−
** protocatechuate 4,5-cleavage
+
** glutathione-sulfide
 +
** glutathione persulfide
  
−
== Reaction(s) found ==
+
== Reaction(s) known to consume the compound ==
−
'''1''' reactions found over '''8''' reactions in the full pathway
+
== Reaction(s) known to produce the compound ==
−
* [[OXALODECARB-RXN]]
+
* [[RXN-15348]]
−
** 3 associated gene(s):
+
== Reaction(s) of unknown directionality ==
−
*** [[Ec-01_003680]]
+
* [[RXN-10851]]
−
*** [[Ec-07_002070]]
+
−
*** [[Ec-07_002060]]
+
−
** 1 reconstruction source(s) associated:
+
−
*** [[annotation-esiliculosus_genome]]
+
−
== Reaction(s) not found ==
+
−
* [http://metacyc.org/META/NEW-IMAGE?object=1.2.1.45-RXN 1.2.1.45-RXN]
+
−
* [http://metacyc.org/META/NEW-IMAGE?object=PROTOCATECHUATE-45-DIOXYGENASE-RXN PROTOCATECHUATE-45-DIOXYGENASE-RXN]
+
−
* [http://metacyc.org/META/NEW-IMAGE?object=R107-RXN R107-RXN]
+
−
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-2462 RXN-2462]
+
−
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-2463 RXN-2463]
+
−
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-2464 RXN-2464]
+
−
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-9983 RXN-9983]
+
 
== External links  ==
 
== External links  ==
−
{{#set: taxonomic range=TAX-1224}}
+
* PUBCHEM:
−
{{#set: common name=protocatechuate degradation I (meta-cleavage pathway)}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=46878477 46878477]
−
{{#set: common name=protocatechuate degradation via meta-cleavage|protocatechuate 4,5-cleavage}}
+
* CHEBI:
−
{{#set: reaction found=1}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58905 58905]
−
{{#set: total reaction=8}}
+
* LIGAND-CPD:
−
{{#set: completion rate=13.0}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C17267 C17267]
 +
{{#set: smiles=C(SS)C(C(NCC([O-])=O)=O)NC(=O)CCC([N+])C([O-])=O}}
 +
{{#set: inchi key=InChIKey=QBOLVLBSUGJHGB-WDSKDSINSA-M}}
 +
{{#set: common name=S-sulfanylglutathione}}
 +
{{#set: molecular weight=338.373    }}
 +
{{#set: common name=GSSH|glutathione-sulfide|glutathione persulfide}}
 +
{{#set: produced by=RXN-15348}}
 +
{{#set: reversible reaction associated=RXN-10851}}

Revision as of 14:36, 21 March 2018

Metabolite CPD-11281

  • smiles:
    • C(SS)C(C(NCC([O-])=O)=O)NC(=O)CCC([N+])C([O-])=O
  • inchi key:
    • InChIKey=QBOLVLBSUGJHGB-WDSKDSINSA-M
  • common name:
    • S-sulfanylglutathione
  • molecular weight:
    • 338.373
  • Synonym(s):
    • GSSH
    • glutathione-sulfide
    • glutathione persulfide

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C(SS)C(C(NCC([O-])=O)=O)NC(=O)CCC([N+])C([O-])=O" cannot be used as a page name in this wiki.




Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=D-MYO-INOSITOL-1-MONOPHOSPHATE&oldid=20081"