Difference between revisions of "RXN-8036"
From metabolic_network
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-1225 RXN-1225] == * direction: ** LEFT-TO-RIGHT * common name: ** Digalactosyldiacylglycerol sy...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-METHYL-CROTONYL-COA 3-METHYL-CROTONYL-COA] == * smiles: ** CC(=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-METHYL-CROTONYL-COA 3-METHYL-CROTONYL-COA] == |
− | * | + | * smiles: |
− | ** | + | ** CC(=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])C |
+ | * inchi key: | ||
+ | ** InChIKey=BXIPALATIYNHJN-ZMHDXICWSA-J | ||
* common name: | * common name: | ||
− | ** | + | ** 3-methylcrotonyl-CoA |
− | * | + | * molecular weight: |
− | ** | + | ** 845.604 |
* Synonym(s): | * Synonym(s): | ||
+ | ** β-methylcrotonoyl-CoA | ||
+ | ** 3-methylbut-2-enoyl-CoA | ||
− | == Reaction | + | == Reaction(s) known to consume the compound == |
− | + | * [[METHYLCROTONYL-COA-CARBOXYLASE-RXN]] | |
− | + | == Reaction(s) known to produce the compound == | |
− | + | * [[RXN0-2301]] | |
− | + | * [[RXN-11921]] | |
− | + | == Reaction(s) of unknown directionality == | |
− | + | * [[RXN-14264]] | |
− | + | ||
− | * [[ | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | == | + | |
− | * [[ | + | |
− | + | ||
− | * [[ | + | |
− | + | ||
− | == | + | |
− | * | + | |
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | * | + | * LIGAND-CPD: |
− | ** [http://www.ebi.ac.uk/ | + | ** [http://www.genome.jp/dbget-bin/www_bget?C03069 C03069] |
− | * | + | * CHEBI: |
− | ** [http:// | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57344 57344] |
− | {{#set: | + | * METABOLIGHTS : MTBLC57344 |
− | {{#set: | + | * PUBCHEM: |
− | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=45266575 45266575] |
− | {{#set: | + | * HMDB : HMDB01493 |
− | {{#set: | + | {{#set: smiles=CC(=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])C}} |
− | {{#set: | + | {{#set: inchi key=InChIKey=BXIPALATIYNHJN-ZMHDXICWSA-J}} |
− | {{#set: | + | {{#set: common name=3-methylcrotonyl-CoA}} |
− | {{#set: | + | {{#set: molecular weight=845.604 }} |
+ | {{#set: common name=β-methylcrotonoyl-CoA|3-methylbut-2-enoyl-CoA}} | ||
+ | {{#set: consumed by=METHYLCROTONYL-COA-CARBOXYLASE-RXN}} | ||
+ | {{#set: produced by=RXN0-2301|RXN-11921}} | ||
+ | {{#set: reversible reaction associated=RXN-14264}} |
Revision as of 14:38, 21 March 2018
Contents
Metabolite 3-METHYL-CROTONYL-COA
- smiles:
- CC(=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])C
- inchi key:
- InChIKey=BXIPALATIYNHJN-ZMHDXICWSA-J
- common name:
- 3-methylcrotonyl-CoA
- molecular weight:
- 845.604
- Synonym(s):
- β-methylcrotonoyl-CoA
- 3-methylbut-2-enoyl-CoA
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC(=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])C" cannot be used as a page name in this wiki.