Difference between revisions of "2.7.1.127-RXN"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PYRIDOXAMINE PYRIDOXAMINE] == * smiles: ** CC1(=NC=C(CO)C(C[N+])=C(O)1) * inchi key: ** InChIKe...") |
(Created page with "Category:Gene == Gene Ec-17_001480 == * left end position: ** 1557036 * transcription direction: ** POSITIVE * right end position: ** 1565361 * centisome position: ** 32.4...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Ec-17_001480 == |
− | * | + | * left end position: |
− | ** | + | ** 1557036 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
− | * | + | * right end position: |
− | ** | + | ** 1565361 |
− | * | + | * centisome position: |
− | ** | + | ** 32.45213 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** Esi_0149_0031 |
+ | ** Esi0149_0031 | ||
+ | ** ALGC | ||
− | == | + | == Reactions associated == |
− | * [[ | + | * Reaction: [[PHOSMANMUT-RXN]] |
− | + | ** Source: [[annotation-esiliculosus_genome]] | |
− | == | + | *** Assignment: ec-number |
+ | * Reaction: [[PHOSPHOGLUCMUT-RXN]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Assignment: automated-name-match | ||
+ | * Reaction: [[RXN-16997]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Assignment: automated-name-match | ||
+ | * Reaction: [[RXN-16998]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Assignment: automated-name-match | ||
+ | == Pathways associated == | ||
+ | * [[PWY-5940]] | ||
+ | * [[PWY-7238]] | ||
+ | * [[PWY-5384]] | ||
+ | * [[PWY-882]] | ||
+ | * [[GLYCOCAT-PWY]] | ||
+ | * [[PWY-7343]] | ||
+ | * [[PWY-3801]] | ||
+ | * [[PWY-622]] | ||
+ | * [[PWY-6731]] | ||
+ | * [[PWY-7456]] | ||
+ | * [[PWY-5659]] | ||
+ | * [[GLUCOSE1PMETAB-PWY]] | ||
+ | * [[PWY-6737]] | ||
+ | * [[PWY-6317]] | ||
+ | * [[PWY-2723]] | ||
+ | * [[GLYCOGENSYNTH-PWY]] | ||
+ | * [[PWY-5661]] | ||
+ | * [[PWY66-422]] | ||
+ | * [[PWY-5941]] | ||
+ | * [[PWY-7586]] | ||
== External links == | == External links == | ||
− | + | {{#set: left end position=1557036}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | + | {{#set: right end position=1565361}} | |
− | + | {{#set: centisome position=32.45213 }} | |
− | + | {{#set: common name=Esi_0149_0031|Esi0149_0031|ALGC}} | |
− | + | {{#set: reaction associated=PHOSMANMUT-RXN|PHOSPHOGLUCMUT-RXN|RXN-16997|RXN-16998}} | |
− | + | {{#set: pathway associated=PWY-5940|PWY-7238|PWY-5384|PWY-882|GLYCOCAT-PWY|PWY-7343|PWY-3801|PWY-622|PWY-6731|PWY-7456|PWY-5659|GLUCOSE1PMETAB-PWY|PWY-6737|PWY-6317|PWY-2723|GLYCOGENSYNTH-PWY|PWY-5661|PWY66-422|PWY-5941|PWY-7586}} | |
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + |
Revision as of 14:38, 21 March 2018
Gene Ec-17_001480
- left end position:
- 1557036
- transcription direction:
- POSITIVE
- right end position:
- 1565361
- centisome position:
- 32.45213
- Synonym(s):
- Esi_0149_0031
- Esi0149_0031
- ALGC
Reactions associated
- Reaction: PHOSMANMUT-RXN
- Source: annotation-esiliculosus_genome
- Assignment: ec-number
- Source: annotation-esiliculosus_genome
- Reaction: PHOSPHOGLUCMUT-RXN
- Source: annotation-esiliculosus_genome
- Assignment: automated-name-match
- Source: annotation-esiliculosus_genome
- Reaction: RXN-16997
- Source: annotation-esiliculosus_genome
- Assignment: automated-name-match
- Source: annotation-esiliculosus_genome
- Reaction: RXN-16998
- Source: annotation-esiliculosus_genome
- Assignment: automated-name-match
- Source: annotation-esiliculosus_genome
Pathways associated
- PWY-5940
- PWY-7238
- PWY-5384
- PWY-882
- GLYCOCAT-PWY
- PWY-7343
- PWY-3801
- PWY-622
- PWY-6731
- PWY-7456
- PWY-5659
- GLUCOSE1PMETAB-PWY
- PWY-6737
- PWY-6317
- PWY-2723
- GLYCOGENSYNTH-PWY
- PWY-5661
- PWY66-422
- PWY-5941
- PWY-7586