Difference between revisions of "Ec-12 007760"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=XYLULOSE-5-PHOSPHATE XYLULOSE-5-PHOSPHATE] == * smiles: ** C(OP([O-])(=O)[O-])C(O)C(O)C(=O)CO *...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-8228 RXN-8228] == * direction: ** LEFT-TO-RIGHT * common name: ** delphinidin 3-O-glucoside 5-O...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-8228 RXN-8228] == |
− | * | + | * direction: |
− | ** | + | ** LEFT-TO-RIGHT |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** delphinidin 3-O-glucoside 5-O-glucosyltransferase |
− | * | + | * ec number: |
− | ** | + | ** [http://enzyme.expasy.org/EC/2.4.1.298 EC-2.4.1.298] |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | == Reaction | + | == Reaction Formula == |
− | = | + | * With identifiers: |
− | * [[ | + | ** 1 [[CPD-7117]][c] '''+''' 1 [[CPD-12575]][c] '''=>''' 1 [[CPD-7139]][c] '''+''' 1 [[UDP]][c] |
− | == | + | * With common name(s): |
− | * [[ | + | ** 1 delphinidin-3-O-β-D-glucoside[c] '''+''' 1 UDP-α-D-glucose[c] '''=>''' 1 delphinidin 3,5-di-O-β-D-glucoside[c] '''+''' 1 UDP[c] |
− | * [[ | + | |
− | * [[ | + | == Genes associated with this reaction == |
+ | Genes have been associated with this reaction based on different elements listed below. | ||
+ | * Gene: [[Ec-04_004610]] | ||
+ | ** Source: [[orthology-aragem]] | ||
+ | * Gene: [[Ec-14_000870]] | ||
+ | ** Source: [[orthology-aragem]] | ||
+ | * Gene: [[Ec-28_003310]] | ||
+ | ** Source: [[orthology-aragem]] | ||
+ | == Pathways == | ||
+ | * [[PWY-5307]], gentiodelphin biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5307 PWY-5307] | ||
+ | ** '''1''' reactions found over '''6''' reactions in the full pathway | ||
+ | == Reconstruction information == | ||
+ | * Category: [[orthology]] | ||
+ | ** Source: [[orthology-aragem]] | ||
+ | *** Tool: [[pantograph]] | ||
== External links == | == External links == | ||
− | + | {{#set: direction=LEFT-TO-RIGHT}} | |
− | + | {{#set: common name=delphinidin 3-O-glucoside 5-O-glucosyltransferase}} | |
− | + | {{#set: ec number=EC-2.4.1.298}} | |
− | + | {{#set: gene associated=Ec-04_004610|Ec-14_000870|Ec-28_003310}} | |
− | + | {{#set: in pathway=PWY-5307}} | |
− | + | {{#set: reconstruction category=orthology}} | |
− | + | {{#set: reconstruction source=orthology-aragem}} | |
− | + | {{#set: reconstruction tool=pantograph}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Revision as of 13:38, 21 March 2018
Contents
Reaction RXN-8228
- direction:
- LEFT-TO-RIGHT
- common name:
- delphinidin 3-O-glucoside 5-O-glucosyltransferase
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- With common name(s):
- 1 delphinidin-3-O-β-D-glucoside[c] + 1 UDP-α-D-glucose[c] => 1 delphinidin 3,5-di-O-β-D-glucoside[c] + 1 UDP[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Ec-04_004610
- Source: orthology-aragem
- Gene: Ec-14_000870
- Source: orthology-aragem
- Gene: Ec-28_003310
- Source: orthology-aragem
Pathways
- PWY-5307, gentiodelphin biosynthesis: PWY-5307
- 1 reactions found over 6 reactions in the full pathway
Reconstruction information
- Category: orthology
- Source: orthology-aragem
- Tool: pantograph
- Source: orthology-aragem