Difference between revisions of "2.3.1.23-RXN"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15318 CPD-15318] == * smiles: ** C(OP([O-])(=O)[O-])C1(C(O)C(O)C(O)O1) * inchi key: ** InCh...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-15740 RXN-15740] == * direction: ** LEFT-TO-RIGHT * common name: ** glycerol-3-phosphate dehydr...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15318 CPD-15318] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-15740 RXN-15740] ==
−
* smiles:
+
* direction:
−
** C(OP([O-])(=O)[O-])C1(C(O)C(O)C(O)O1)
+
** LEFT-TO-RIGHT
−
* inchi key:
+
−
** InChIKey=KTVPXOYAKDPRHY-AIHAYLRMSA-L
+
 
* common name:
 
* common name:
−
** α-D-ribose 5-phosphate
+
** glycerol-3-phosphate dehydrogenase
−
* molecular weight:
+
* ec number:
−
** 228.095   
+
** [http://enzyme.expasy.org/EC/1.1.5.3 EC-1.1.5.3]
 
* Synonym(s):
 
* Synonym(s):
−
** α-D-ribofuranose 5-phosphate
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[RXN-14997]]
+
* With identifiers:
−
* [[RXN-15345]]
+
** 1 [[GLYCEROL-3P]][c] '''+''' 1 [[Menaquinones]][c] '''=>''' 1 [[Menaquinols]][c] '''+''' 1 [[DIHYDROXY-ACETONE-PHOSPHATE]][c]
−
== Reaction(s) known to produce the compound ==
+
* With common name(s):
−
* [[RIBOKIN-RXN]]
+
** 1 sn-glycerol 3-phosphate[c] '''+''' 1 a menaquinone[c] '''=>''' 1 a menaquinol[c] '''+''' 1 glycerone phosphate[c]
−
== Reaction(s) of unknown directionality ==
+
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Ec-10_003310]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: GO-TERM
 +
== Pathways  ==
 +
* [[PWY0-1582]], glycerol-3-phosphate to fumarate electron transfer: [http://metacyc.org/META/NEW-IMAGE?object=PWY0-1582 PWY0-1582]
 +
** '''1''' reactions found over '''2''' reactions in the full pathway
 +
* [[PWY0-1581]], nitrate reduction IX (dissimilatory): [http://metacyc.org/META/NEW-IMAGE?object=PWY0-1581 PWY0-1581]
 +
** '''1''' reactions found over '''2''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[annotation]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: direction=LEFT-TO-RIGHT}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=7098640 7098640]
+
{{#set: common name=glycerol-3-phosphate dehydrogenase}}
−
* CHEBI:
+
{{#set: ec number=EC-1.1.5.3}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=18189 18189]
+
{{#set: gene associated=Ec-10_003310}}
−
* METABOLIGHTS : MTBLC18189
+
{{#set: in pathway=PWY0-1582|PWY0-1581}}
−
{{#set: smiles=C(OP([O-])(=O)[O-])C1(C(O)C(O)C(O)O1)}}
+
{{#set: reconstruction category=annotation}}
−
{{#set: inchi key=InChIKey=KTVPXOYAKDPRHY-AIHAYLRMSA-L}}
+
{{#set: reconstruction source=annotation-esiliculosus_genome}}
−
{{#set: common name=α-D-ribose 5-phosphate}}
+
{{#set: reconstruction tool=pathwaytools}}
−
{{#set: molecular weight=228.095    }}
+
−
{{#set: common name=α-D-ribofuranose 5-phosphate}}
+
−
{{#set: consumed by=RXN-14997|RXN-15345}}
+
−
{{#set: produced by=RIBOKIN-RXN}}
+

Revision as of 14:39, 21 March 2018

Reaction RXN-15740

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • glycerol-3-phosphate dehydrogenase
  • ec number:
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY0-1582, glycerol-3-phosphate to fumarate electron transfer: PWY0-1582
    • 1 reactions found over 2 reactions in the full pathway
  • PWY0-1581, nitrate reduction IX (dissimilatory): PWY0-1581
    • 1 reactions found over 2 reactions in the full pathway

Reconstruction information

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=2.3.1.23-RXN&oldid=20493"