Difference between revisions of "2OXOGLUTDECARB-RXN"
From metabolic_network
(Created page with "Category:Gene == Gene Ec-27_004200 == * left end position: ** 3700794 * transcription direction: ** NEGATIVE * right end position: ** 3704123 * centisome position: ** 57.3...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8620 CPD-8620] == * smiles: ** CC(C)CCCC([CH]4(C1(C)([CH](C2(=C(CC1)C3(C)([CH](CC2)CC(=O)CC...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8620 CPD-8620] == |
| − | * | + | * smiles: |
| − | ** | + | ** CC(C)CCCC([CH]4(C1(C)([CH](C2(=C(CC1)C3(C)([CH](CC2)CC(=O)CC3)))CC4)))C |
| − | * | + | * inchi key: |
| − | ** | + | ** InChIKey=RZSXSHNNQBIPTL-ZSBATXSLSA-N |
| − | * | + | * common name: |
| − | ** | + | ** 5α-cholesta-8-en-3-one |
| − | * | + | * molecular weight: |
| − | ** | + | ** 384.644 |
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | |||
| − | |||
| − | == | + | == Reaction(s) known to consume the compound == |
| − | + | == Reaction(s) known to produce the compound == | |
| − | + | * [[RXN66-23]] | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | + | ||
| − | + | ||
| − | == | + | |
| − | + | ||
== External links == | == External links == | ||
| − | + | * PUBCHEM: | |
| − | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25203379 25203379] | |
| − | {{#set: | + | * HMDB : HMDB12178 |
| − | {{#set: | + | {{#set: smiles=CC(C)CCCC([CH]4(C1(C)([CH](C2(=C(CC1)C3(C)([CH](CC2)CC(=O)CC3)))CC4)))C}} |
| − | {{#set: common name= | + | {{#set: inchi key=InChIKey=RZSXSHNNQBIPTL-ZSBATXSLSA-N}} |
| − | {{#set: | + | {{#set: common name=5α-cholesta-8-en-3-one}} |
| − | {{#set: | + | {{#set: molecular weight=384.644 }} |
| + | {{#set: produced by=RXN66-23}} | ||
Revision as of 13:39, 21 March 2018
Contents
Metabolite CPD-8620
- smiles:
- CC(C)CCCC([CH]4(C1(C)([CH](C2(=C(CC1)C3(C)([CH](CC2)CC(=O)CC3)))CC4)))C
- inchi key:
- InChIKey=RZSXSHNNQBIPTL-ZSBATXSLSA-N
- common name:
- 5α-cholesta-8-en-3-one
- molecular weight:
- 384.644
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- PUBCHEM:
- HMDB : HMDB12178
"CC(C)CCCC([CH]4(C1(C)([CH](C2(=C(CC1)C3(C)([CH](CC2)CC(=O)CC3)))CC4)))C" cannot be used as a page name in this wiki.
