Difference between revisions of "ACYLCOADEHYDROG-RXN"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12853 CPD-12853] == * smiles: ** CC(C)=CCCC(C)[CH]3(CC=C4(C2(CC[CH]1(C(C)C(O)CCC(C)1C=2CCC(...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-15044 RXN-15044] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/EC/...")
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Reaction]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12853 CPD-12853] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-15044 RXN-15044] ==
* smiles:
+
* direction:
** CC(C)=CCCC(C)[CH]3(CC=C4(C2(CC[CH]1(C(C)C(O)CCC(C)1C=2CCC(C)34))))
+
** LEFT-TO-RIGHT
* inchi key:
+
* ec number:
** InChIKey=QJVMEAZHJKXWJD-HESBYNJASA-N
+
** [http://enzyme.expasy.org/EC/2.3.1.42 EC-2.3.1.42]
* common name:
+
** 4α-methyl-5α-cholesta-8,14,24-trien-3β-ol
+
* molecular weight:
+
** 396.655   
+
 
* Synonym(s):
 
* Synonym(s):
** cholesta-8,14,24-trien-3-ol, 4-methyl-, (3β,4α,5α)-
 
  
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
== Reaction(s) known to produce the compound ==
+
* With identifiers:
* [[RXN-11881]]
+
** 1 [[OLEOYL-COA]][c] '''+''' 1 [[DIHYDROXY-ACETONE-PHOSPHATE]][c] '''=>''' 1 [[CPD-15924]][c] '''+''' 1 [[CO-A]][c]
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 1 oleoyl-CoA[c] '''+''' 1 glycerone phosphate[c] '''=>''' 1 1-oleoyl-2-lyso-glycerone phosphate[c] '''+''' 1 coenzyme A[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
== Pathways  ==
 +
* [[PWY-7411]], superpathway of phosphatidate biosynthesis (yeast): [http://metacyc.org/META/NEW-IMAGE?object=PWY-7411 PWY-7411]
 +
** '''5''' reactions found over '''5''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[annotation]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: direction=LEFT-TO-RIGHT}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=50986075 50986075]
+
{{#set: ec number=EC-2.3.1.42}}
{{#set: smiles=CC(C)=CCCC(C)[CH]3(CC=C4(C2(CC[CH]1(C(C)C(O)CCC(C)1C=2CCC(C)34))))}}
+
{{#set: in pathway=PWY-7411}}
{{#set: inchi key=InChIKey=QJVMEAZHJKXWJD-HESBYNJASA-N}}
+
{{#set: reconstruction category=annotation}}
{{#set: common name=4α-methyl-5α-cholesta-8,14,24-trien-3β-ol}}
+
{{#set: reconstruction source=annotation-esiliculosus_genome}}
{{#set: molecular weight=396.655    }}
+
{{#set: reconstruction tool=pathwaytools}}
{{#set: common name=cholesta-8,14,24-trien-3-ol, 4-methyl-, (3β,4α,5α)-}}
+
{{#set: produced by=RXN-11881}}
+

Revision as of 14:39, 21 March 2018

Reaction RXN-15044

  • direction:
    • LEFT-TO-RIGHT
  • ec number:
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Pathways

  • PWY-7411, superpathway of phosphatidate biosynthesis (yeast): PWY-7411
    • 5 reactions found over 5 reactions in the full pathway

Reconstruction information

External links