Difference between revisions of "2.1.1.72-RXN"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=D-GLUCARATE D-GLUCARATE] == * smiles: ** C(=O)(C(O)C(O)C(O)C(O)C(=O)[O-])[O-] * inchi key: ** I...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=TREHALOSE-6P TREHALOSE-6P] == * smiles: ** C(C1(OC(C(C(C1O)O)O)OC2(C(C(C(C(O2)COP([O-])(=O)[O-]...") |
||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=TREHALOSE-6P TREHALOSE-6P] == |
* smiles: | * smiles: | ||
− | ** C( | + | ** C(C1(OC(C(C(C1O)O)O)OC2(C(C(C(C(O2)COP([O-])(=O)[O-])O)O)O)))O |
* inchi key: | * inchi key: | ||
− | ** InChIKey= | + | ** InChIKey=LABSPYBHMPDTEL-LIZSDCNHSA-L |
* common name: | * common name: | ||
− | ** | + | ** α,α-trehalose 6-phosphate |
* molecular weight: | * molecular weight: | ||
− | ** | + | ** 420.263 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** α,α-D-trehalose 6-phosphate |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
+ | * [[TREHALOSEPHOSPHA-RXN]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
+ | * [[TREHALOSE6PSYN-RXN]] | ||
+ | * [[2.4.1.36-RXN]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | * [[RXN- | + | * [[RXN-761]] |
== External links == | == External links == | ||
− | * CAS : | + | * CAS : 4484-88-2 |
− | + | ||
* PUBCHEM: | * PUBCHEM: | ||
− | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25246105 25246105] |
− | * HMDB : | + | * HMDB : HMDB01124 |
* LIGAND-CPD: | * LIGAND-CPD: | ||
− | ** [http://www.genome.jp/dbget-bin/www_bget? | + | ** [http://www.genome.jp/dbget-bin/www_bget?C00689 C00689] |
− | + | ||
− | + | ||
* CHEBI: | * CHEBI: | ||
− | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58429 58429] |
− | * | + | * BIGG : 35708 |
− | {{#set: smiles=C( | + | {{#set: smiles=C(C1(OC(C(C(C1O)O)O)OC2(C(C(C(C(O2)COP([O-])(=O)[O-])O)O)O)))O}} |
− | {{#set: inchi key=InChIKey= | + | {{#set: inchi key=InChIKey=LABSPYBHMPDTEL-LIZSDCNHSA-L}} |
− | {{#set: common name= | + | {{#set: common name=α,α-trehalose 6-phosphate}} |
− | {{#set: molecular weight= | + | {{#set: molecular weight=420.263 }} |
− | {{#set: common name= | + | {{#set: common name=α,α-D-trehalose 6-phosphate}} |
− | {{#set: reversible reaction associated=RXN- | + | {{#set: consumed by=TREHALOSEPHOSPHA-RXN}} |
+ | {{#set: produced by=TREHALOSE6PSYN-RXN|2.4.1.36-RXN}} | ||
+ | {{#set: reversible reaction associated=RXN-761}} |
Revision as of 14:40, 21 March 2018
Contents
Metabolite TREHALOSE-6P
- smiles:
- C(C1(OC(C(C(C1O)O)O)OC2(C(C(C(C(O2)COP([O-])(=O)[O-])O)O)O)))O
- inchi key:
- InChIKey=LABSPYBHMPDTEL-LIZSDCNHSA-L
- common name:
- α,α-trehalose 6-phosphate
- molecular weight:
- 420.263
- Synonym(s):
- α,α-D-trehalose 6-phosphate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C(C1(OC(C(C(C1O)O)O)OC2(C(C(C(C(O2)COP([O-])(=O)[O-])O)O)O)))O" cannot be used as a page name in this wiki.