Difference between revisions of "Ec-20 000540"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Gene == Gene Ec-27_000530 == * Synonym(s): ** Esi_0122_0080 ** Esi0122_0080 ** Pyruvate dehydro == Reactions associated == * PYRUVDEH-RXN ** pantograph-[...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-236 CPD-236] == * smiles: ** C=C1(C3(O)(CC4(C1)(C([CH]5(C2(C(=O)OC(CC(O)C2)([CH](CC3)4)5)(C...")
Line 1: Line 1:
−
[[Category:Gene]]
+
[[Category:Metabolite]]
−
== Gene Ec-27_000530 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-236 CPD-236] ==
 +
* smiles:
 +
** C=C1(C3(O)(CC4(C1)(C([CH]5(C2(C(=O)OC(CC(O)C2)([CH](CC3)4)5)(C)))C([O-])=O)))
 +
* inchi key:
 +
** InChIKey=BKBYHSYZKIAJDA-LPEMZMRWSA-M
 +
* common name:
 +
** gibberellin A29
 +
* molecular weight:
 +
** 347.387   
 
* Synonym(s):
 
* Synonym(s):
−
** Esi_0122_0080
+
** GA29
−
** Esi0122_0080
+
−
** Pyruvate dehydro
+
  
−
== Reactions associated ==
+
== Reaction(s) known to consume the compound ==
−
* [[PYRUVDEH-RXN]]
+
== Reaction(s) known to produce the compound ==
−
** [[pantograph]]-[[aragem]]
+
* [[RXN-113]]
−
* [[RXN-12583]]
+
== Reaction(s) of unknown directionality ==
−
** [[pantograph]]-[[aragem]]
+
−
== Pathways associated ==
+
−
* [[PWY-7218]]
+
−
* [[PWY-7384]]
+
−
* [[PWY-6886]]
+
−
* [[PWY-5537]]
+
−
* [[GLYCOLYSIS-TCA-GLYOX-BYPASS]]
+
−
* [[PWY-5482]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: common name=Esi_0122_0080|Esi0122_0080|Pyruvate dehydro}}
+
* PUBCHEM:
−
{{#set: reaction associated=PYRUVDEH-RXN|RXN-12583}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25200412 25200412]
−
{{#set: pathway associated=PWY-7218|PWY-7384|PWY-6886|PWY-5537|GLYCOLYSIS-TCA-GLYOX-BYPASS|PWY-5482}}
+
* CHEBI:
 +
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=28040 28040]
 +
* LIGAND-CPD:
 +
** [http://www.genome.jp/dbget-bin/www_bget?C06096 C06096]
 +
{{#set: smiles=C=C1(C3(O)(CC4(C1)(C([CH]5(C2(C(=O)OC(CC(O)C2)([CH](CC3)4)5)(C)))C([O-])=O)))}}
 +
{{#set: inchi key=InChIKey=BKBYHSYZKIAJDA-LPEMZMRWSA-M}}
 +
{{#set: common name=gibberellin A29}}
 +
{{#set: molecular weight=347.387    }}
 +
{{#set: common name=GA29}}
 +
{{#set: produced by=RXN-113}}

Revision as of 14:41, 21 March 2018

Metabolite CPD-236

  • smiles:
    • C=C1(C3(O)(CC4(C1)(C([CH]5(C2(C(=O)OC(CC(O)C2)([CH](CC3)4)5)(C)))C([O-])=O)))
  • inchi key:
    • InChIKey=BKBYHSYZKIAJDA-LPEMZMRWSA-M
  • common name:
    • gibberellin A29
  • molecular weight:
    • 347.387
  • Synonym(s):
    • GA29

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C=C1(C3(O)(CC4(C1)(C([CH]5(C2(C(=O)OC(CC(O)C2)([CH](CC3)4)5)(C)))C([O-])=O)))" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Ec-20_000540&oldid=20713"