Difference between revisions of "Ec-07 005770"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14971 RXN-14971] == * direction: ** LEFT-TO-RIGHT * common name: ** Succinate dehydrogenase/fum...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-1162 CPD0-1162] == * smiles: ** CCCCCCCCC=CCC=CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O...")
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14971 RXN-14971] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-1162 CPD0-1162] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** CCCCCCCCC=CCC=CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O
 +
* inchi key:
 +
** InChIKey=JVEFYXPCQBMMAA-ZMLWRGBOSA-J
 
* common name:
 
* common name:
−
** Succinate dehydrogenase/fumarate reductase flavoprotein, catalytic domain
+
** (2E,5Z)-tetradecenoyl-CoA
−
** SDH1, succinate dehydrogenase subunit 1
+
* molecular weight:
−
** SDH3, succinate dehydrogenase subunit 3
+
** 969.83   
−
** SDH2, succinate dehydrogenase subunit 2
+
−
** SDH4, succinate dehydrogenase subunit 4
+
−
* ec number:
+
−
** [http://enzyme.expasy.org/EC/1.3.5.1 EC-1.3.5.1]
+
 
* Synonym(s):
 
* Synonym(s):
 +
** 2-trans,5-cis-tetradecenoyl-CoA
 +
** 14:2-Δ2,Δ5-CoA
 +
** 2-trans,5-cis-tetradecadienoyl-CoA
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
* [[RXN0-5393]]
−
** 1 [[SUC]][c] '''+''' 1 [[ETR-Quinones]][c] '''=>''' 1 [[ETR-Quinols]][c] '''+''' 1 [[FUM]][c]
+
== Reaction(s) known to produce the compound ==
−
* With common name(s):
+
* [[RXN-14576]]
−
** 1 succinate[c] '''+''' 1 an electron-transfer quinone[c] '''=>''' 1 an electron-transfer quinol[c] '''+''' 1 fumarate[c]
+
* [[RXN-17783]]
−
 
+
== Reaction(s) of unknown directionality ==
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* [[Ec-07_007310]]
+
−
** ESILICULOSUS_GENOME
+
−
***EC-NUMBER
+
−
* [[Ec-27_006560]]
+
−
** ESILICULOSUS_GENOME
+
−
***AUTOMATED-NAME-MATCH
+
−
* [[Ec-07_002870]]
+
−
** ESILICULOSUS_GENOME
+
−
***EC-NUMBER
+
−
* [[Ec-11_000360]]
+
−
** ESILICULOSUS_GENOME
+
−
***EC-NUMBER
+
−
* [[Ec-05_003640]]
+
−
** ESILICULOSUS_GENOME
+
−
***AUTOMATED-NAME-MATCH
+
−
* [[Ec-21_003470]]
+
−
** ESILICULOSUS_GENOME
+
−
***EC-NUMBER
+
−
== Pathways  ==
+
−
* [[PWY-7254]], TCA cycle VII (acetate-producers): [http://metacyc.org/META/NEW-IMAGE?object=PWY-7254 PWY-7254]
+
−
** '''7''' reactions found over '''9''' reactions in the full pathway
+
−
* [[P105-PWY]], TCA cycle IV (2-oxoglutarate decarboxylase): [http://metacyc.org/META/NEW-IMAGE?object=P105-PWY P105-PWY]
+
−
** '''9''' reactions found over '''11''' reactions in the full pathway
+
−
* [[PWY-6969]], TCA cycle V (2-oxoglutarate:ferredoxin oxidoreductase): [http://metacyc.org/META/NEW-IMAGE?object=PWY-6969 PWY-6969]
+
−
** '''10''' reactions found over '''12''' reactions in the full pathway
+
−
== Reconstruction information  ==
+
−
* Category: [[annotation]]
+
−
** Source: [[annotation-esiliculosus_genome]]
+
−
*** Tool: [[pathwaytools]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: direction=LEFT-TO-RIGHT}}
+
* PUBCHEM:
−
{{#set: common name=Succinate dehydrogenase/fumarate reductase flavoprotein, catalytic domain}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25244134 25244134]
−
{{#set: common name=SDH1, succinate dehydrogenase subunit 1}}
+
* CHEBI:
−
{{#set: common name=SDH3, succinate dehydrogenase subunit 3}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=87701 87701]
−
{{#set: common name=SDH2, succinate dehydrogenase subunit 2}}
+
{{#set: smiles=CCCCCCCCC=CCC=CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O}}
−
{{#set: common name=SDH4, succinate dehydrogenase subunit 4}}
+
{{#set: inchi key=InChIKey=JVEFYXPCQBMMAA-ZMLWRGBOSA-J}}
−
{{#set: ec number=EC-1.3.5.1}}
+
{{#set: common name=(2E,5Z)-tetradecenoyl-CoA}}
−
{{#set: gene associated=Ec-07_007310|Ec-27_006560|Ec-07_002870|Ec-11_000360|Ec-05_003640|Ec-21_003470}}
+
{{#set: molecular weight=969.83    }}
−
{{#set: in pathway=PWY-7254|P105-PWY|PWY-6969}}
+
{{#set: common name=2-trans,5-cis-tetradecenoyl-CoA|14:2-Δ2,Δ5-CoA|2-trans,5-cis-tetradecadienoyl-CoA}}
−
{{#set: reconstruction category=annotation}}
+
{{#set: consumed by=RXN0-5393}}
−
{{#set: reconstruction source=annotation-esiliculosus_genome}}
+
{{#set: produced by=RXN-14576|RXN-17783}}
−
{{#set: reconstruction tool=pathwaytools}}
+

Revision as of 13:41, 21 March 2018

Metabolite CPD0-1162

  • smiles:
    • CCCCCCCCC=CCC=CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O
  • inchi key:
    • InChIKey=JVEFYXPCQBMMAA-ZMLWRGBOSA-J
  • common name:
    • (2E,5Z)-tetradecenoyl-CoA
  • molecular weight:
    • 969.83
  • Synonym(s):
    • 2-trans,5-cis-tetradecenoyl-CoA
    • 14:2-Δ2,Δ5-CoA
    • 2-trans,5-cis-tetradecadienoyl-CoA

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CCCCCCCCC=CCC=CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O" cannot be used as a page name in this wiki.




Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Ec-07_005770&oldid=20753"