|
|
Line 1: |
Line 1: |
− | [[Category:Reaction]] | + | [[Category:Metabolite]] |
− | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=NARINGENIN-CHALCONE-SYNTHASE-RXN NARINGENIN-CHALCONE-SYNTHASE-RXN] == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-2743 CPD-2743] == |
− | * direction: | + | * smiles: |
− | ** LEFT-TO-RIGHT | + | ** C1(CC[CH](N(=O)(C)1)C2(=CN=CC=C2)) |
− | * ec number: | + | * inchi key: |
− | ** [http://enzyme.expasy.org/EC/2.3.1.74 EC-2.3.1.74] | + | ** InChIKey=RWFBQHICRCUQJJ-NUHJPDEHSA-N |
| + | * common name: |
| + | ** nicotine-1'-N-oxide |
| + | * molecular weight: |
| + | ** 178.233 |
| * Synonym(s): | | * Synonym(s): |
| + | ** nicotine N'-oxide |
| | | |
− | == Reaction Formula == | + | == Reaction(s) known to consume the compound == |
− | * With identifiers:
| + | == Reaction(s) known to produce the compound == |
− | ** 1 [[P-COUMAROYL-COA]][c] '''+''' 3 [[MALONYL-COA]][c] '''+''' 3 [[PROTON]][c] '''=>''' 4 [[CO-A]][c] '''+''' 1 [[APIGENIN]][c] '''+''' 3 [[CARBON-DIOXIDE]][c]
| + | * [[RXN66-81]] |
− | * With common name(s):
| + | == Reaction(s) of unknown directionality == |
− | ** 1 4-coumaroyl-CoA[c] '''+''' 3 malonyl-CoA[c] '''+''' 3 H+[c] '''=>''' 4 coenzyme A[c] '''+''' 1 2',4,4',6'-tetrahydroxychalcone[c] '''+''' 3 CO2[c]
| + | |
− | | + | |
− | == Genes associated with this reaction == | + | |
− | Genes have been associated with this reaction based on different elements listed below.
| + | |
− | * [[Ec-07_003670]]
| + | |
− | ** [[pantograph]]-[[aragem]]
| + | |
− | * [[Ec-07_006660]]
| + | |
− | ** [[pantograph]]-[[aragem]]
| + | |
− | * [[Ec-02_004580]]
| + | |
− | ** [[pantograph]]-[[aragem]]
| + | |
− | == Pathways == | + | |
− | * [[PWY-6316]], aromatic polyketides biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6316 PWY-6316]
| + | |
− | ** '''1''' reactions found over '''2''' reactions in the full pathway
| + | |
− | * [[PWY-7397]], naringenin biosynthesis (engineered): [http://metacyc.org/META/NEW-IMAGE?object=PWY-7397 PWY-7397]
| + | |
− | ** '''3''' reactions found over '''4''' reactions in the full pathway
| + | |
− | * [[PWY1F-FLAVSYN]], flavonoid biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY1F-FLAVSYN PWY1F-FLAVSYN]
| + | |
− | ** '''5''' reactions found over '''5''' reactions in the full pathway
| + | |
− | * [[PWY-5135]], xanthohumol biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5135 PWY-5135]
| + | |
− | ** '''2''' reactions found over '''4''' reactions in the full pathway
| + | |
− | * [[PWY-6787]], flavonoid biosynthesis (in equisetum): [http://metacyc.org/META/NEW-IMAGE?object=PWY-6787 PWY-6787] | + | |
− | ** '''6''' reactions found over '''10''' reactions in the full pathway
| + | |
− | == Reconstruction information == | + | |
− | * Category: [[orthology]]
| + | |
− | ** Source: [[orthology-aragem]]
| + | |
− | *** Tool: [[pantograph]]
| + | |
| == External links == | | == External links == |
− | * RHEA: | + | * PUBCHEM: |
− | ** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=11128 11128] | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=68107 68107] |
− | * LIGAND-RXN: | + | * CHEMSPIDER: |
− | ** [http://www.genome.jp/dbget-bin/www_bget?R01613 R01613] | + | ** [http://www.chemspider.com/Chemical-Structure.61415.html 61415] |
− | * UNIPROT:
| + | * HMDB : HMDB01497 |
− | ** [http://www.uniprot.org/uniprot/Q43188 Q43188]
| + | {{#set: smiles=C1(CC[CH](N(=O)(C)1)C2(=CN=CC=C2))}} |
− | ** [http://www.uniprot.org/uniprot/O04934 O04934] | + | {{#set: inchi key=InChIKey=RWFBQHICRCUQJJ-NUHJPDEHSA-N}} |
− | ** [http://www.uniprot.org/uniprot/P17957 P17957]
| + | {{#set: common name=nicotine-1'-N-oxide}} |
− | ** [http://www.uniprot.org/uniprot/P30081 P30081]
| + | {{#set: molecular weight=178.233 }} |
− | ** [http://www.uniprot.org/uniprot/P30080 P30080]
| + | {{#set: common name=nicotine N'-oxide}} |
− | ** [http://www.uniprot.org/uniprot/Q9S9C0 Q9S9C0]
| + | {{#set: produced by=RXN66-81}} |
− | ** [http://www.uniprot.org/uniprot/Q9S9B9 Q9S9B9]
| + | |
− | ** [http://www.uniprot.org/uniprot/P23419 P23419]
| + | |
− | ** [http://www.uniprot.org/uniprot/P26018 P26018]
| + | |
− | ** [http://www.uniprot.org/uniprot/P22928 P22928]
| + | |
− | ** [http://www.uniprot.org/uniprot/P30079 P30079]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q01287 Q01287]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q01288 Q01288]
| + | |
− | ** [http://www.uniprot.org/uniprot/P51078 P51078]
| + | |
− | ** [http://www.uniprot.org/uniprot/P51080 P51080]
| + | |
− | ** [http://www.uniprot.org/uniprot/P30078 P30078]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q01286 Q01286]
| + | |
− | ** [http://www.uniprot.org/uniprot/P30073 P30073]
| + | |
− | ** [http://www.uniprot.org/uniprot/P30074 P30074]
| + | |
− | ** [http://www.uniprot.org/uniprot/P30076 P30076]
| + | |
− | ** [http://www.uniprot.org/uniprot/P30077 P30077]
| + | |
− | ** [http://www.uniprot.org/uniprot/P51089 P51089]
| + | |
− | ** [http://www.uniprot.org/uniprot/P51075 P51075]
| + | |
− | ** [http://www.uniprot.org/uniprot/P16107 P16107]
| + | |
− | ** [http://www.uniprot.org/uniprot/P51077 P51077]
| + | |
− | ** [http://www.uniprot.org/uniprot/P51079 P51079]
| + | |
− | ** [http://www.uniprot.org/uniprot/P30075 P30075]
| + | |
− | ** [http://www.uniprot.org/uniprot/P51081 P51081]
| + | |
− | ** [http://www.uniprot.org/uniprot/P51082 P51082]
| + | |
− | ** [http://www.uniprot.org/uniprot/P48390 P48390]
| + | |
− | ** [http://www.uniprot.org/uniprot/P48405 P48405]
| + | |
− | ** [http://www.uniprot.org/uniprot/P48406 P48406]
| + | |
− | ** [http://www.uniprot.org/uniprot/P23569 P23569]
| + | |
− | ** [http://www.uniprot.org/uniprot/P13416 P13416]
| + | |
− | ** [http://www.uniprot.org/uniprot/P13417 P13417]
| + | |
− | ** [http://www.uniprot.org/uniprot/P17818 P17818]
| + | |
− | ** [http://www.uniprot.org/uniprot/P13114 P13114]
| + | |
− | ** [http://www.uniprot.org/uniprot/P08894 P08894]
| + | |
− | ** [http://www.uniprot.org/uniprot/P22924 P22924]
| + | |
− | ** [http://www.uniprot.org/uniprot/P22925 P22925]
| + | |
− | ** [http://www.uniprot.org/uniprot/P22926 P22926]
| + | |
− | ** [http://www.uniprot.org/uniprot/P22927 P22927]
| + | |
− | ** [http://www.uniprot.org/uniprot/P06515 P06515]
| + | |
− | ** [http://www.uniprot.org/uniprot/P24826 P24826]
| + | |
− | ** [http://www.uniprot.org/uniprot/P19168 P19168]
| + | |
− | ** [http://www.uniprot.org/uniprot/P24825 P24825]
| + | |
− | ** [http://www.uniprot.org/uniprot/P24824 P24824]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q40005 Q40005]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q96562 Q96562]
| + | |
− | ** [http://www.uniprot.org/uniprot/O22047 O22047]
| + | |
− | ** [http://www.uniprot.org/uniprot/O04971 O04971]
| + | |
− | ** [http://www.uniprot.org/uniprot/P48389 P48389]
| + | |
− | ** [http://www.uniprot.org/uniprot/P48398 P48398]
| + | |
− | ** [http://www.uniprot.org/uniprot/P48399 P48399]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q96568 Q96568]
| + | |
− | ** [http://www.uniprot.org/uniprot/P48397 P48397]
| + | |
− | ** [http://www.uniprot.org/uniprot/O04966 O04966]
| + | |
− | ** [http://www.uniprot.org/uniprot/O04967 O04967]
| + | |
− | ** [http://www.uniprot.org/uniprot/O04968 O04968]
| + | |
− | ** [http://www.uniprot.org/uniprot/O04969 O04969]
| + | |
− | ** [http://www.uniprot.org/uniprot/O04970 O04970]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q41292 Q41292]
| + | |
− | {{#set: direction=LEFT-TO-RIGHT}} | + | |
− | {{#set: ec number=EC-2.3.1.74}}
| + | |
− | {{#set: gene associated=Ec-07_003670|Ec-07_006660|Ec-02_004580}} | + | |
− | {{#set: in pathway=PWY-6316|PWY-7397|PWY1F-FLAVSYN|PWY-5135|PWY-6787}} | + | |
− | {{#set: reconstruction category=orthology}} | + | |
− | {{#set: reconstruction source=orthology-aragem}} | + | |
− | {{#set: reconstruction tool=pantograph}} | + | |