Difference between revisions of "CPD-8291"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=P3I P3I] == * smiles: ** [O-]P(OP(=O)(OP([O-])(=O)[O-])[O-])([O-])=O * inchi key: ** InChIKey=U...") |
(Created page with "Category:Gene == Gene Ec-22_001510 == * left end position: ** 1789846 * transcription direction: ** NEGATIVE * right end position: ** 1792960 * centisome position: ** 39.6...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Ec-22_001510 == |
− | * | + | * left end position: |
− | ** | + | ** 1789846 |
− | * | + | * transcription direction: |
− | ** | + | ** NEGATIVE |
− | * | + | * right end position: |
− | ** | + | ** 1792960 |
− | * | + | * centisome position: |
− | ** | + | ** 39.634743 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** Esi_0423_0004 |
− | ** | + | ** Esi0423_0004 |
− | + | ||
− | + | ||
− | + | ||
− | == | + | == Reactions associated == |
− | + | * Reaction: [[RXN-9463]] | |
− | + | ** Source: [[annotation-esiliculosus_genome]] | |
− | * [[ | + | *** Assignment: automated-name-match |
− | * | + | == Pathways associated == |
− | * [[ | + | * [[PWY-5936]] |
− | + | ||
== External links == | == External links == | ||
− | + | {{#set: left end position=1789846}} | |
− | + | {{#set: transcription direction=NEGATIVE}} | |
− | + | {{#set: right end position=1792960}} | |
− | + | {{#set: centisome position=39.634743 }} | |
− | + | {{#set: common name=Esi_0423_0004|Esi0423_0004}} | |
− | + | {{#set: reaction associated=RXN-9463}} | |
− | + | {{#set: pathway associated=PWY-5936}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + |
Revision as of 13:41, 21 March 2018
Gene Ec-22_001510
- left end position:
- 1789846
- transcription direction:
- NEGATIVE
- right end position:
- 1792960
- centisome position:
- 39.634743
- Synonym(s):
- Esi_0423_0004
- Esi0423_0004
Reactions associated
- Reaction: RXN-9463
- Source: annotation-esiliculosus_genome
- Assignment: automated-name-match
- Source: annotation-esiliculosus_genome