Difference between revisions of "Ec-18 000990"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=HOMO-CIS-ACONITATE HOMO-CIS-ACONITATE] == * smiles: ** C(=O)([O-])C=C(CCC([O-])=O)C(=O)[O-] * i...") |
(Created page with "Category:Gene == Gene Ec-11_003080 == * left end position: ** 3222076 * transcription direction: ** POSITIVE * right end position: ** 3236973 * centisome position: ** 51.2...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Ec-11_003080 == |
− | * | + | * left end position: |
− | ** | + | ** 3222076 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
− | * | + | * right end position: |
− | ** | + | ** 3236973 |
− | * | + | * centisome position: |
− | ** | + | ** 51.22816 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** Esi_0048_0101 |
− | ** | + | ** Esi0048_0101 |
− | + | ||
− | + | ||
− | == | + | == Reactions associated == |
− | * [[ | + | * Reaction: [[ISOCITDEH-RXN]] |
− | + | ** Source: [[annotation-esiliculosus_genome]] | |
− | * [[ | + | *** Assignment: go-term |
− | == | + | * Reaction: [[RXN-8642]] |
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Assignment: go-term | ||
+ | * Reaction: [[RXN-9951]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Assignment: go-term | ||
+ | == Pathways associated == | ||
+ | * [[PWY-5913]] | ||
+ | * [[REDCITCYC]] | ||
+ | * [[PWY-7268]] | ||
+ | * [[P23-PWY]] | ||
+ | * [[P105-PWY]] | ||
+ | * [[PWY-6969]] | ||
+ | * [[FERMENTATION-PWY]] | ||
+ | * [[PWY-6728]] | ||
+ | * [[PWY-6549]] | ||
+ | * [[PWY-7254]] | ||
+ | * [[PWY-7124]] | ||
+ | * [[TCA]] | ||
== External links == | == External links == | ||
− | + | {{#set: left end position=3222076}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | + | {{#set: right end position=3236973}} | |
− | + | {{#set: centisome position=51.22816 }} | |
− | + | {{#set: common name=Esi_0048_0101|Esi0048_0101}} | |
− | + | {{#set: reaction associated=ISOCITDEH-RXN|RXN-8642|RXN-9951}} | |
− | + | {{#set: pathway associated=PWY-5913|REDCITCYC|PWY-7268|P23-PWY|P105-PWY|PWY-6969|FERMENTATION-PWY|PWY-6728|PWY-6549|PWY-7254|PWY-7124|TCA}} | |
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | {{#set: | + |
Revision as of 13:42, 21 March 2018
Gene Ec-11_003080
- left end position:
- 3222076
- transcription direction:
- POSITIVE
- right end position:
- 3236973
- centisome position:
- 51.22816
- Synonym(s):
- Esi_0048_0101
- Esi0048_0101
Reactions associated
- Reaction: ISOCITDEH-RXN
- Source: annotation-esiliculosus_genome
- Assignment: go-term
- Source: annotation-esiliculosus_genome
- Reaction: RXN-8642
- Source: annotation-esiliculosus_genome
- Assignment: go-term
- Source: annotation-esiliculosus_genome
- Reaction: RXN-9951
- Source: annotation-esiliculosus_genome
- Assignment: go-term
- Source: annotation-esiliculosus_genome
Pathways associated
- PWY-5913
- REDCITCYC
- PWY-7268
- P23-PWY
- P105-PWY
- PWY-6969
- FERMENTATION-PWY
- PWY-6728
- PWY-6549
- PWY-7254
- PWY-7124
- TCA