Difference between revisions of "Reduced-NrdH-Proteins"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=C4 C4] == * smiles: ** CC(C)=CCCC(C)=CCCC(C)=CCCC(=CCCC(=CCCC(=CCCC(C)=CCCC(=CCCC(=CCCC(=CCCC(=...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-1302 CPD-1302] == * smiles: ** CN1([CH](CNC2(N=C(NC(=O)C1=2)N))CNC3(=CC=C(C(=O)NC(C([O-])=O...") |
||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-1302 CPD-1302] == |
* smiles: | * smiles: | ||
− | ** | + | ** CN1([CH](CNC2(N=C(NC(=O)C1=2)N))CNC3(=CC=C(C(=O)NC(C([O-])=O)CCC(NC(C([O-])=O)CCC(NC(C([O-])=O)CCC(=O)[O-])=O)=O)C=C3)) |
* inchi key: | * inchi key: | ||
− | ** InChIKey= | + | ** InChIKey=HVRNKDVLFAVCJF-VJANTYMQSA-J |
* common name: | * common name: | ||
− | ** | + | ** N5-methyl--tetrahydropteroyl tri-L-glutamate |
* molecular weight: | * molecular weight: | ||
− | ** | + | ** 713.66 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** N5-methyl--H4PteGlu3 |
− | + | ** 5-methyltetrahydropteroyl tri-L-glutamate | |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
+ | * [[RXN-12730]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | * [[ | + | * [[HOMOCYSMET-RXN]] |
== External links == | == External links == | ||
* PUBCHEM: | * PUBCHEM: | ||
− | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=49852302 49852302] |
+ | * CHEMSPIDER: | ||
+ | ** [http://www.chemspider.com/Chemical-Structure.17625689.html 17625689] | ||
* CHEBI: | * CHEBI: | ||
− | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58207 58207] |
* LIGAND-CPD: | * LIGAND-CPD: | ||
− | ** [http://www.genome.jp/dbget-bin/www_bget? | + | ** [http://www.genome.jp/dbget-bin/www_bget?C04489 C04489] |
− | {{#set: smiles= | + | * HMDB : HMDB12177 |
− | {{#set: inchi key=InChIKey= | + | {{#set: smiles=CN1([CH](CNC2(N=C(NC(=O)C1=2)N))CNC3(=CC=C(C(=O)NC(C([O-])=O)CCC(NC(C([O-])=O)CCC(NC(C([O-])=O)CCC(=O)[O-])=O)=O)C=C3))}} |
− | {{#set: common name= | + | {{#set: inchi key=InChIKey=HVRNKDVLFAVCJF-VJANTYMQSA-J}} |
− | {{#set: molecular weight= | + | {{#set: common name=N5-methyl--tetrahydropteroyl tri-L-glutamate}} |
− | {{#set: common name= | + | {{#set: molecular weight=713.66 }} |
− | {{#set: reversible reaction associated= | + | {{#set: common name=N5-methyl--H4PteGlu3|5-methyltetrahydropteroyl tri-L-glutamate}} |
+ | {{#set: consumed by=RXN-12730}} | ||
+ | {{#set: reversible reaction associated=HOMOCYSMET-RXN}} |
Revision as of 13:42, 21 March 2018
Contents
Metabolite CPD-1302
- smiles:
- CN1([CH](CNC2(N=C(NC(=O)C1=2)N))CNC3(=CC=C(C(=O)NC(C([O-])=O)CCC(NC(C([O-])=O)CCC(NC(C([O-])=O)CCC(=O)[O-])=O)=O)C=C3))
- inchi key:
- InChIKey=HVRNKDVLFAVCJF-VJANTYMQSA-J
- common name:
- N5-methyl--tetrahydropteroyl tri-L-glutamate
- molecular weight:
- 713.66
- Synonym(s):
- N5-methyl--H4PteGlu3
- 5-methyltetrahydropteroyl tri-L-glutamate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CN1([CH](CNC2(N=C(NC(=O)C1=2)N))CNC3(=CC=C(C(=O)NC(C([O-])=O)CCC(NC(C([O-])=O)CCC(NC(C([O-])=O)CCC(=O)[O-])=O)=O)C=C3))" cannot be used as a page name in this wiki.