Difference between revisions of "Ec-17 000400"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=FRUCTOSE-6P FRUCTOSE-6P] == * smiles: ** C(OP(=O)([O-])[O-])C1(OC(CO)(O)C(O)C(O)1) * inchi key:...") |
(Created page with "Category:Gene == Gene Ec-18_001510 == * left end position: ** 1502212 * transcription direction: ** NEGATIVE * right end position: ** 1503331 * centisome position: ** 30.4...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Ec-18_001510 == |
− | * | + | * left end position: |
− | ** | + | ** 1502212 |
− | * | + | * transcription direction: |
− | ** | + | ** NEGATIVE |
− | * | + | * right end position: |
− | ** | + | ** 1503331 |
− | * | + | * centisome position: |
− | ** | + | ** 30.492126 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** Esi_0199_0061 |
− | ** | + | ** Esi0199_0061 |
− | ** | + | ** GST |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | == | + | == Reactions associated == |
− | * [[ | + | * Reaction: [[GSHTRAN-RXN]] |
− | * [[ | + | ** Source: [[annotation-esiliculosus_genome]] |
− | + | *** Assignment: ec-number | |
− | * [[ | + | * Reaction: [[GST-RXN]] |
− | * [[ | + | ** Source: [[annotation-esiliculosus_genome]] |
− | * [[ | + | *** Assignment: ec-number |
− | + | * Reaction: [[RXN-13673]] | |
− | * [[ | + | ** Source: [[annotation-esiliculosus_genome]] |
− | * [[ | + | *** Assignment: ec-number |
− | * [[ | + | * Reaction: [[RXN-15680]] |
− | * [[ | + | ** Source: [[annotation-esiliculosus_genome]] |
− | * [[ | + | *** Assignment: ec-number |
− | * [[ | + | == Pathways associated == |
− | * [[ | + | * [[PWY-7112]] |
+ | * [[PWY-6842]] | ||
+ | * [[PWY-4061]] | ||
+ | * [[PWY-7533]] | ||
== External links == | == External links == | ||
− | + | {{#set: left end position=1502212}} | |
− | + | {{#set: transcription direction=NEGATIVE}} | |
− | + | {{#set: right end position=1503331}} | |
− | + | {{#set: centisome position=30.492126 }} | |
− | + | {{#set: common name=Esi_0199_0061|Esi0199_0061|GST}} | |
− | + | {{#set: reaction associated=GSHTRAN-RXN|GST-RXN|RXN-13673|RXN-15680}} | |
− | + | {{#set: pathway associated=PWY-7112|PWY-6842|PWY-4061|PWY-7533}} | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | + | ||
− | {{#set: | + |
Revision as of 13:43, 21 March 2018
Gene Ec-18_001510
- left end position:
- 1502212
- transcription direction:
- NEGATIVE
- right end position:
- 1503331
- centisome position:
- 30.492126
- Synonym(s):
- Esi_0199_0061
- Esi0199_0061
- GST
Reactions associated
- Reaction: GSHTRAN-RXN
- Source: annotation-esiliculosus_genome
- Assignment: ec-number
- Source: annotation-esiliculosus_genome
- Reaction: GST-RXN
- Source: annotation-esiliculosus_genome
- Assignment: ec-number
- Source: annotation-esiliculosus_genome
- Reaction: RXN-13673
- Source: annotation-esiliculosus_genome
- Assignment: ec-number
- Source: annotation-esiliculosus_genome
- Reaction: RXN-15680
- Source: annotation-esiliculosus_genome
- Assignment: ec-number
- Source: annotation-esiliculosus_genome