Difference between revisions of "CHORISMATEMUT-RXN"
From metabolic_network
(Created page with "Category:Gene == Gene Ec-19_004000 == * left end position: ** 4338466 * transcription direction: ** POSITIVE * right end position: ** 4353256 * centisome position: ** 72.6...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD1F-132 CPD1F-132] == * smiles: ** C=C1(C4(CC3(C1)(CC[CH]2(C(C)(C([O-])=O)CCCC(C)2[CH]3CC4)))...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD1F-132 CPD1F-132] == |
| − | * | + | * smiles: |
| − | ** | + | ** C=C1(C4(CC3(C1)(CC[CH]2(C(C)(C([O-])=O)CCCC(C)2[CH]3CC4)))) |
| − | * | + | * inchi key: |
| − | ** | + | ** InChIKey=NIKHGUQULKYIGE-OTCXFQBHSA-M |
| − | * | + | * common name: |
| − | ** | + | ** ent-kaur-16-en-19-oate |
| − | * | + | * molecular weight: |
| − | ** | + | ** 301.448 |
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** ent-kaurenoate |
| − | ** | + | ** ent-kaurenoic acid |
| − | + | ||
| − | == | + | == Reaction(s) known to consume the compound == |
| − | * [[RXN | + | * [[1.14.13.79-RXN]] |
| − | + | == Reaction(s) known to produce the compound == | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | == | + | |
== External links == | == External links == | ||
| − | {{#set: | + | * LIPID_MAPS : LMPR0104130004 |
| − | {{#set: | + | * PUBCHEM: |
| − | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25200785 25200785] |
| − | {{#set: | + | * CHEBI: |
| − | {{#set: common name= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57297 57297] |
| − | {{#set: | + | * LIGAND-CPD: |
| + | ** [http://www.genome.jp/dbget-bin/www_bget?C11874 C11874] | ||
| + | {{#set: smiles=C=C1(C4(CC3(C1)(CC[CH]2(C(C)(C([O-])=O)CCCC(C)2[CH]3CC4))))}} | ||
| + | {{#set: inchi key=InChIKey=NIKHGUQULKYIGE-OTCXFQBHSA-M}} | ||
| + | {{#set: common name=ent-kaur-16-en-19-oate}} | ||
| + | {{#set: molecular weight=301.448 }} | ||
| + | {{#set: common name=ent-kaurenoate|ent-kaurenoic acid}} | ||
| + | {{#set: consumed by=1.14.13.79-RXN}} | ||
Revision as of 13:44, 21 March 2018
Contents
Metabolite CPD1F-132
- smiles:
- C=C1(C4(CC3(C1)(CC[CH]2(C(C)(C([O-])=O)CCCC(C)2[CH]3CC4))))
- inchi key:
- InChIKey=NIKHGUQULKYIGE-OTCXFQBHSA-M
- common name:
- ent-kaur-16-en-19-oate
- molecular weight:
- 301.448
- Synonym(s):
- ent-kaurenoate
- ent-kaurenoic acid
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C=C1(C4(CC3(C1)(CC[CH]2(C(C)(C([O-])=O)CCCC(C)2[CH]3CC4))))" cannot be used as a page name in this wiki.
