Difference between revisions of "Ec-03 002790"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD1F-132 CPD1F-132] == * smiles: ** C=C1(C4(CC3(C1)(CC[CH]2(C(C)(C([O-])=O)CCCC(C)2[CH]3CC4)))...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-12624 RXN-12624] == * direction: ** LEFT-TO-RIGHT * common name: ** chitinase-domain containing...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD1F-132 CPD1F-132] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-12624 RXN-12624] ==
−
* smiles:
+
* direction:
−
** C=C1(C4(CC3(C1)(CC[CH]2(C(C)(C([O-])=O)CCCC(C)2[CH]3CC4))))
+
** LEFT-TO-RIGHT
−
* inchi key:
+
−
** InChIKey=NIKHGUQULKYIGE-OTCXFQBHSA-M
+
 
* common name:
 
* common name:
−
** ent-kaur-16-en-19-oate
+
** chitinase-domain containing protein
−
* molecular weight:
+
* ec number:
−
** 301.448   
+
** [http://enzyme.expasy.org/EC/3.2.1.14 EC-3.2.1.14]
 
* Synonym(s):
 
* Synonym(s):
−
** ent-kaurenoate
+
** endolytic chitodextrinase
−
** ent-kaurenoic acid
+
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[1.14.13.79-RXN]]
+
* With identifiers:
−
== Reaction(s) known to produce the compound ==
+
** 1 [[Chitodextrins]][c] '''+''' 1 [[WATER]][c] '''=>''' n [[CPD-13227]][c]
−
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 1 a chitodextrin[c] '''+''' 1 H2O[c] '''=>''' n chitotriose[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Ec-05_006850]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: AUTOMATED-NAME-MATCH
 +
== Pathways  ==
 +
* [[PWY-6902]], chitin degradation II: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6902 PWY-6902]
 +
** '''4''' reactions found over '''5''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[annotation]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
−
* LIPID_MAPS : LMPR0104130004
+
{{#set: direction=LEFT-TO-RIGHT}}
−
* PUBCHEM:
+
{{#set: common name=chitinase-domain containing protein}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25200785 25200785]
+
{{#set: ec number=EC-3.2.1.14}}
−
* CHEBI:
+
{{#set: common name=endolytic chitodextrinase}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57297 57297]
+
{{#set: gene associated=Ec-05_006850}}
−
* LIGAND-CPD:
+
{{#set: in pathway=PWY-6902}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C11874 C11874]
+
{{#set: reconstruction category=annotation}}
−
{{#set: smiles=C=C1(C4(CC3(C1)(CC[CH]2(C(C)(C([O-])=O)CCCC(C)2[CH]3CC4))))}}
+
{{#set: reconstruction source=annotation-esiliculosus_genome}}
−
{{#set: inchi key=InChIKey=NIKHGUQULKYIGE-OTCXFQBHSA-M}}
+
{{#set: reconstruction tool=pathwaytools}}
−
{{#set: common name=ent-kaur-16-en-19-oate}}
+
−
{{#set: molecular weight=301.448    }}
+
−
{{#set: common name=ent-kaurenoate|ent-kaurenoic acid}}
+
−
{{#set: consumed by=1.14.13.79-RXN}}
+

Revision as of 14:44, 21 March 2018

Reaction RXN-12624

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • chitinase-domain containing protein
  • ec number:
  • Synonym(s):
    • endolytic chitodextrinase

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1 a chitodextrin[c] + 1 H2O[c] => n chitotriose[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-6902, chitin degradation II: PWY-6902
    • 4 reactions found over 5 reactions in the full pathway

Reconstruction information

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Ec-03_002790&oldid=21142"