Difference between revisions of "3.2.1.96-RXN"
From metabolic_network
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN1F-163 RXN1F-163] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/EC/...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9446 CPD-9446] == * smiles: ** C(O)C1(OCC(O)C(O)C(O)1) * inchi key: ** InChIKey=MPCAJMNYNOG...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9446 CPD-9446] == |
− | * | + | * smiles: |
− | ** | + | ** C(O)C1(OCC(O)C(O)C(O)1) |
− | * | + | * inchi key: |
− | ** | + | ** InChIKey=MPCAJMNYNOGXPB-KVTDHHQDSA-N |
+ | * common name: | ||
+ | ** 1,5-anhydro-D-mannitol | ||
+ | * molecular weight: | ||
+ | ** 164.158 | ||
* Synonym(s): | * Synonym(s): | ||
+ | ** 1,5-anhydromannitol | ||
− | == Reaction | + | == Reaction(s) known to consume the compound == |
− | + | * [[RXN-13064]] | |
− | + | == Reaction(s) known to produce the compound == | |
− | + | == Reaction(s) of unknown directionality == | |
− | + | ||
− | + | ||
− | = | + | |
− | + | ||
− | * [[ | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | == | + | |
− | + | ||
− | + | ||
− | == | + | |
− | + | ||
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | * LIGAND- | + | * PUBCHEM: |
− | ** [http://www.genome.jp/dbget-bin/www_bget? | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=445184 445184] |
− | {{#set: | + | * CHEMSPIDER: |
− | {{#set: | + | ** [http://www.chemspider.com/Chemical-Structure.392897.html 392897] |
− | {{#set: | + | * CHEBI: |
− | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=49182 49182] |
− | {{#set: | + | * LIGAND-CPD: |
− | + | ** [http://www.genome.jp/dbget-bin/www_bget?C16538 C16538] | |
− | {{#set: | + | {{#set: smiles=C(O)C1(OCC(O)C(O)C(O)1)}} |
+ | {{#set: inchi key=InChIKey=MPCAJMNYNOGXPB-KVTDHHQDSA-N}} | ||
+ | {{#set: common name=1,5-anhydro-D-mannitol}} | ||
+ | {{#set: molecular weight=164.158 }} | ||
+ | {{#set: common name=1,5-anhydromannitol}} | ||
+ | {{#set: consumed by=RXN-13064}} |
Revision as of 13:44, 21 March 2018
Contents
Metabolite CPD-9446
- smiles:
- C(O)C1(OCC(O)C(O)C(O)1)
- inchi key:
- InChIKey=MPCAJMNYNOGXPB-KVTDHHQDSA-N
- common name:
- 1,5-anhydro-D-mannitol
- molecular weight:
- 164.158
- Synonym(s):
- 1,5-anhydromannitol
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links