Difference between revisions of "3.2.1.96-RXN"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN1F-163 RXN1F-163] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/EC/...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9446 CPD-9446] == * smiles: ** C(O)C1(OCC(O)C(O)C(O)1) * inchi key: ** InChIKey=MPCAJMNYNOG...")
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN1F-163 RXN1F-163] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9446 CPD-9446] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** C(O)C1(OCC(O)C(O)C(O)1)
−
* ec number:
+
* inchi key:
−
** [http://enzyme.expasy.org/EC/1.14.11 EC-1.14.11]
+
** InChIKey=MPCAJMNYNOGXPB-KVTDHHQDSA-N
 +
* common name:
 +
** 1,5-anhydro-D-mannitol
 +
* molecular weight:
 +
** 164.158   
 
* Synonym(s):
 
* Synonym(s):
 +
** 1,5-anhydromannitol
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
* [[RXN-13064]]
−
** 1 [[CPD1F-97]][c] '''+''' 1 [[OXYGEN-MOLECULE]][c] '''+''' 1 [[2-KETOGLUTARATE]][c] '''=>''' 1 [[WATER]][c] '''+''' 1 [[SUC]][c] '''+''' 1 [[CARBON-DIOXIDE]][c] '''+''' 1 [[CPD1F-120]][c]
+
== Reaction(s) known to produce the compound ==
−
* With common name(s):
+
== Reaction(s) of unknown directionality ==
−
** 1 gibberellin A15 (open lactone form)[c] '''+''' 1 oxygen[c] '''+''' 1 2-oxoglutarate[c] '''=>''' 1 H2O[c] '''+''' 1 succinate[c] '''+''' 1 CO2[c] '''+''' 1 gibberellin A24[c]
+
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* [[Ec-08_003510]]
+
−
** [[pantograph]]-[[aragem]]
+
−
* [[Ec-19_002750]]
+
−
** [[pantograph]]-[[aragem]]
+
−
* [[Ec-19_002760]]
+
−
** [[pantograph]]-[[aragem]]
+
−
== Pathways  ==
+
−
* [[PWY-5070]], gibberellin biosynthesis I (non C-3, non C-13 hydroxylation): [http://metacyc.org/META/NEW-IMAGE?object=PWY-5070 PWY-5070]
+
−
** '''3''' reactions found over '''7''' reactions in the full pathway
+
−
== Reconstruction information  ==
+
−
* Category: [[orthology]]
+
−
** Source: [[orthology-aragem]]
+
−
*** Tool: [[pantograph]]
+
 
== External links  ==
 
== External links  ==
−
* LIGAND-RXN:
+
* PUBCHEM:
−
** [http://www.genome.jp/dbget-bin/www_bget?R06323 R06323]
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=445184 445184]
−
{{#set: direction=LEFT-TO-RIGHT}}
+
* CHEMSPIDER:
−
{{#set: ec number=EC-1.14.11}}
+
** [http://www.chemspider.com/Chemical-Structure.392897.html 392897]
−
{{#set: gene associated=Ec-08_003510|Ec-19_002750|Ec-19_002760}}
+
* CHEBI:
−
{{#set: in pathway=PWY-5070}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=49182 49182]
−
{{#set: reconstruction category=orthology}}
+
* LIGAND-CPD:
−
{{#set: reconstruction source=orthology-aragem}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C16538 C16538]
−
{{#set: reconstruction tool=pantograph}}
+
{{#set: smiles=C(O)C1(OCC(O)C(O)C(O)1)}}
 +
{{#set: inchi key=InChIKey=MPCAJMNYNOGXPB-KVTDHHQDSA-N}}
 +
{{#set: common name=1,5-anhydro-D-mannitol}}
 +
{{#set: molecular weight=164.158    }}
 +
{{#set: common name=1,5-anhydromannitol}}
 +
{{#set: consumed by=RXN-13064}}

Revision as of 13:44, 21 March 2018

Metabolite CPD-9446

  • smiles:
    • C(O)C1(OCC(O)C(O)C(O)1)
  • inchi key:
    • InChIKey=MPCAJMNYNOGXPB-KVTDHHQDSA-N
  • common name:
    • 1,5-anhydro-D-mannitol
  • molecular weight:
    • 164.158
  • Synonym(s):
    • 1,5-anhydromannitol

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links




Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=3.2.1.96-RXN&oldid=21189"