Difference between revisions of "CPD1G-774"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=D-TRYPTOPHAN D-TRYPTOPHAN] == * smiles: ** C2(NC1(C=CC=CC=1C(CC([N+])C(=O)[O-])=2)) * inchi key...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-10614 RXN-10614] == * direction: ** LEFT-TO-RIGHT * common name: ** Aryl sulfotransferase ** P-...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=D-TRYPTOPHAN D-TRYPTOPHAN] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-10614 RXN-10614] ==
−
* smiles:
+
* direction:
−
** C2(NC1(C=CC=CC=1C(CC([N+])C(=O)[O-])=2))
+
** LEFT-TO-RIGHT
−
* inchi key:
+
−
** InChIKey=QIVBCDIJIAJPQS-SECBINFHSA-N
+
 
* common name:
 
* common name:
−
** D-tryptophan
+
** Aryl sulfotransferase
−
* molecular weight:
+
** P-loop containing nucleoside triphosphate hydrolase
−
** 204.228   
+
** Sulfotransferase domain
 +
* ec number:
 +
** [http://enzyme.expasy.org/EC/2.8.2.1 EC-2.8.2.1]
 
* Synonym(s):
 
* Synonym(s):
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[RXN-8664]]
+
* With identifiers:
−
== Reaction(s) known to produce the compound ==
+
** 1 [[PAPS]][c] '''+''' 1 [[L-THYROXINE]][c] '''=>''' 1 [[PROTON]][c] '''+''' 1 [[3-5-ADP]][c] '''+''' 1 [[CPD-11407]][c]
−
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 1 3'-phosphoadenylyl-sulfate[c] '''+''' 1 L-thyroxine[c] '''=>''' 1 H+[c] '''+''' 1 adenosine 3',5'-bisphosphate[c] '''+''' 1 thyroxine sulfate[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Ec-06_007320]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Ec-06_007300]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Ec-06_007310]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Ec-26_003630]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Ec-00_005410]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: EC-NUMBER
 +
== Pathways  ==
 +
* [[PWY-6261]], thyroid hormone metabolism II (via conjugation and/or degradation): [http://metacyc.org/META/NEW-IMAGE?object=PWY-6261 PWY-6261]
 +
** '''2''' reactions found over '''15''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[annotation]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
−
* NCI:
+
{{#set: direction=LEFT-TO-RIGHT}}
−
** [http://cactus.nci.nih.gov/ncidb2.2/?nsc=97942 97942]
+
{{#set: common name=Aryl sulfotransferase}}
−
* CAS : 153-94-6
+
{{#set: common name=P-loop containing nucleoside triphosphate hydrolase}}
−
* PUBCHEM:
+
{{#set: common name=Sulfotransferase domain}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=6923517 6923517]
+
{{#set: ec number=EC-2.8.2.1}}
−
* HMDB : HMDB13609
+
{{#set: gene associated=Ec-06_007320|Ec-06_007300|Ec-06_007310|Ec-26_003630|Ec-00_005410}}
−
* LIGAND-CPD:
+
{{#set: in pathway=PWY-6261}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C00525 C00525]
+
{{#set: reconstruction category=annotation}}
−
* CHEBI:
+
{{#set: reconstruction source=annotation-esiliculosus_genome}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57719 57719]
+
{{#set: reconstruction tool=pathwaytools}}
−
* METABOLIGHTS : MTBLC57719
+
−
{{#set: smiles=C2(NC1(C=CC=CC=1C(CC([N+])C(=O)[O-])=2))}}
+
−
{{#set: inchi key=InChIKey=QIVBCDIJIAJPQS-SECBINFHSA-N}}
+
−
{{#set: common name=D-tryptophan}}
+
−
{{#set: molecular weight=204.228    }}
+
−
{{#set: consumed by=RXN-8664}}
+

Revision as of 13:45, 21 March 2018

Reaction RXN-10614

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • Aryl sulfotransferase
    • P-loop containing nucleoside triphosphate hydrolase
    • Sulfotransferase domain
  • ec number:
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1 3'-phosphoadenylyl-sulfate[c] + 1 L-thyroxine[c] => 1 H+[c] + 1 adenosine 3',5'-bisphosphate[c] + 1 thyroxine sulfate[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-6261, thyroid hormone metabolism II (via conjugation and/or degradation): PWY-6261
    • 2 reactions found over 15 reactions in the full pathway

Reconstruction information

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=CPD1G-774&oldid=21313"