Difference between revisions of "Ec-02 006230"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Gene == Gene Ec-06_003660 == * left end position: ** 3013922 * transcription direction: ** POSITIVE * right end position: ** 3020872 * centisome position: ** 34.4...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12303 CPD-12303] == * smiles: ** CC(C)=CCCC(C)=CCCC(C)=CCCC(=CCCC(=CCCC(=CCCC(C)=CCCC(=CCCC...")
Line 1: Line 1:
[[Category:Gene]]
+
[[Category:Metabolite]]
== Gene Ec-06_003660 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12303 CPD-12303] ==
* left end position:
+
* smiles:
** 3013922
+
** CC(C)=CCCC(C)=CCCC(C)=CCCC(=CCCC(=CCCC(=CCCC(C)=CCCC(=CCCC(=CCCC(=CCCC(=CCOP(OP([O-])(=O)OC1(C(NC(=O)C)C(OC(C)C(=O)NC(C)C(=O)NC(C(=O)[O-])CCC(=O)NC(CCCC[N+])C(NC(C)C(=O)[O-])=O)C(O)C(CO)O1))([O-])=O)C)C)C)C)C)C)C
* transcription direction:
+
* inchi key:
** POSITIVE
+
** InChIKey=KCROFJGXXSCHGA-YGMFIXCYSA-K
* right end position:
+
* common name:
** 3020872
+
** undecaprenyl-diphospho-N-acetylmuramoyl-L-alanyl-γ-D-glutamyl-L-lysyl- D-alanine
* centisome position:
+
* molecular weight:
** 34.41431    
+
** 1598.955    
 
* Synonym(s):
 
* Synonym(s):
** Esi_0246_0037
+
** mur2Ac(oyl-L-Ala-γ-D-Glu-L-Lys-D-Ala)-diphosphoundecaprenol
** Esi0246_0037
+
** lipid I (tetrapeptide)
  
== Reactions associated ==
+
== Reaction(s) known to consume the compound ==
* [[PROTEIN-TYROSINE-PHOSPHATASE-RXN]]
+
== Reaction(s) known to produce the compound ==
** esiliculosus_genome
+
* [[RXN-11347]]
***automated-name-match
+
== Reaction(s) of unknown directionality ==
== Pathways associated ==
+
 
== External links  ==
 
== External links  ==
{{#set: left end position=3013922}}
+
* PUBCHEM:
{{#set: transcription direction=POSITIVE}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90657616 90657616]
{{#set: right end position=3020872}}
+
{{#set: smiles=CC(C)=CCCC(C)=CCCC(C)=CCCC(=CCCC(=CCCC(=CCCC(C)=CCCC(=CCCC(=CCCC(=CCCC(=CCOP(OP([O-])(=O)OC1(C(NC(=O)C)C(OC(C)C(=O)NC(C)C(=O)NC(C(=O)[O-])CCC(=O)NC(CCCC[N+])C(NC(C)C(=O)[O-])=O)C(O)C(CO)O1))([O-])=O)C)C)C)C)C)C)C}}
{{#set: centisome position=34.41431   }}
+
{{#set: inchi key=InChIKey=KCROFJGXXSCHGA-YGMFIXCYSA-K}}
{{#set: common name=Esi_0246_0037|Esi0246_0037}}
+
{{#set: common name=undecaprenyl-diphospho-N-acetylmuramoyl-L-alanyl-γ-D-glutamyl-L-lysyl- D-alanine}}
{{#set: reaction associated=PROTEIN-TYROSINE-PHOSPHATASE-RXN}}
+
{{#set: molecular weight=1598.955   }}
 +
{{#set: common name=mur2Ac(oyl-L-Ala-γ-D-Glu-L-Lys-D-Ala)-diphosphoundecaprenol|lipid I (tetrapeptide)}}
 +
{{#set: produced by=RXN-11347}}

Revision as of 13:45, 21 March 2018

Metabolite CPD-12303

  • smiles:
    • CC(C)=CCCC(C)=CCCC(C)=CCCC(=CCCC(=CCCC(=CCCC(C)=CCCC(=CCCC(=CCCC(=CCCC(=CCOP(OP([O-])(=O)OC1(C(NC(=O)C)C(OC(C)C(=O)NC(C)C(=O)NC(C(=O)[O-])CCC(=O)NC(CCCC[N+])C(NC(C)C(=O)[O-])=O)C(O)C(CO)O1))([O-])=O)C)C)C)C)C)C)C
  • inchi key:
    • InChIKey=KCROFJGXXSCHGA-YGMFIXCYSA-K
  • common name:
    • undecaprenyl-diphospho-N-acetylmuramoyl-L-alanyl-γ-D-glutamyl-L-lysyl- D-alanine
  • molecular weight:
    • 1598.955
  • Synonym(s):
    • mur2Ac(oyl-L-Ala-γ-D-Glu-L-Lys-D-Ala)-diphosphoundecaprenol
    • lipid I (tetrapeptide)

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CC(C)=CCCC(C)=CCCC(C)=CCCC(=CCCC(=CCCC(=CCCC(C)=CCCC(=CCCC(=CCCC(=CCCC(=CCOP(OP([O-])(=O)OC1(C(NC(=O)C)C(OC(C)C(=O)NC(C)C(=O)NC(C(=O)[O-])CCC(=O)NC(CCCC[N+])C(NC(C)C(=O)[O-])=O)C(O)C(CO)O1))([O-])=O)C)C)C)C)C)C)C" cannot be used as a page name in this wiki.