Difference between revisions of "16-HYDROXYPALMITATE"
From metabolic_network
(Created page with "Category:Gene == Gene Ec-12_001440 == * left end position: ** 1427876 * transcription direction: ** NEGATIVE * right end position: ** 1432137 * centisome position: ** 17.1...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CANAVANINOSUCCINATE CANAVANINOSUCCINATE] == * smiles: ** C(ONC(=[N+])NC(CC(=O)[O-])C(=O)[O-])CC...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CANAVANINOSUCCINATE CANAVANINOSUCCINATE] == |
| − | * | + | * smiles: |
| − | ** | + | ** C(ONC(=[N+])NC(CC(=O)[O-])C(=O)[O-])CC([N+])C([O-])=O |
| − | * | + | * inchi key: |
| − | ** | + | ** InChIKey=SGYMGUGIGTWWLU-ROLXFIACSA-M |
| − | * | + | * common name: |
| − | ** | + | ** canavaninosuccinate |
| − | * | + | * molecular weight: |
| − | ** | + | ** 291.24 |
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | |||
| − | |||
| − | == | + | == Reaction(s) known to consume the compound == |
| − | * [[ | + | * [[RXN-22]] |
| − | + | == Reaction(s) known to produce the compound == | |
| − | + | * [[RXN-10]] | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | + | ||
| − | + | ||
| − | == | + | |
| − | * [[ | + | |
| − | + | ||
== External links == | == External links == | ||
| − | + | * PUBCHEM: | |
| − | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=91820246 91820246] |
| − | {{#set: | + | * HMDB : HMDB12197 |
| − | {{#set: | + | {{#set: smiles=C(ONC(=[N+])NC(CC(=O)[O-])C(=O)[O-])CC([N+])C([O-])=O}} |
| − | {{#set: | + | {{#set: inchi key=InChIKey=SGYMGUGIGTWWLU-ROLXFIACSA-M}} |
| − | {{#set: | + | {{#set: common name=canavaninosuccinate}} |
| − | {{#set: | + | {{#set: molecular weight=291.24 }} |
| + | {{#set: consumed by=RXN-22}} | ||
| + | {{#set: produced by=RXN-10}} | ||
Revision as of 13:46, 21 March 2018
Contents
Metabolite CANAVANINOSUCCINATE
- smiles:
- C(ONC(=[N+])NC(CC(=O)[O-])C(=O)[O-])CC([N+])C([O-])=O
- inchi key:
- InChIKey=SGYMGUGIGTWWLU-ROLXFIACSA-M
- common name:
- canavaninosuccinate
- molecular weight:
- 291.24
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- PUBCHEM:
- HMDB : HMDB12197
"C(ONC(=[N+])NC(CC(=O)[O-])C(=O)[O-])CC([N+])C([O-])=O" cannot be used as a page name in this wiki.
