Difference between revisions of "2-PHOSPHO-4-CYTIDINE-5-DIPHOSPHO-2-C-MET"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Gene == Gene Ec-14_006440 == * left end position: ** 5929702 * transcription direction: ** POSITIVE * right end position: ** 5935902 * centisome position: ** 90.3...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15435 CPD-15435] == * smiles: ** CC(O)C(C([O-])=O)NC(=O)OP(OCC3(C(C(C(N2(C1(=C(C(=NC=N1)N)N...")
Line 1: Line 1:
−
[[Category:Gene]]
+
[[Category:Metabolite]]
−
== Gene Ec-14_006440 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15435 CPD-15435] ==
−
* left end position:
+
* smiles:
−
** 5929702
+
** CC(O)C(C([O-])=O)NC(=O)OP(OCC3(C(C(C(N2(C1(=C(C(=NC=N1)N)N=C2)))O3)O)O))([O-])=O
−
* transcription direction:
+
* inchi key:
−
** POSITIVE
+
** InChIKey=GHLUPQUHEIJRCU-DWVDDHQFSA-L
−
* right end position:
+
* common name:
−
** 5935902
+
** L-threonylcarbamoyladenylate
−
* centisome position:
+
* molecular weight:
−
** 90.3859    
+
** 490.322    
 
* Synonym(s):
 
* Synonym(s):
−
** Esi_0063_0023
 
−
** Esi0063_0023
 
−
** SEPSECS
 
  
−
== Reactions associated ==
+
== Reaction(s) known to consume the compound ==
−
* [[RXN-10039]]
+
* [[RXN-14570]]
−
** esiliculosus_genome
+
== Reaction(s) known to produce the compound ==
−
***automated-name-match
+
== Reaction(s) of unknown directionality ==
−
== Pathways associated ==
+
* [[RXN-14569]]
−
* [[PWY-6281]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: left end position=5929702}}
+
* PUBCHEM:
−
{{#set: transcription direction=POSITIVE}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=71464565 71464565]
−
{{#set: right end position=5935902}}
+
* CHEBI:
−
{{#set: centisome position=90.3859    }}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=73682 73682]
−
{{#set: common name=Esi_0063_0023|Esi0063_0023|SEPSECS}}
+
{{#set: smiles=CC(O)C(C([O-])=O)NC(=O)OP(OCC3(C(C(C(N2(C1(=C(C(=NC=N1)N)N=C2)))O3)O)O))([O-])=O}}
−
{{#set: reaction associated=RXN-10039}}
+
{{#set: inchi key=InChIKey=GHLUPQUHEIJRCU-DWVDDHQFSA-L}}
−
{{#set: pathway associated=PWY-6281}}
+
{{#set: common name=L-threonylcarbamoyladenylate}}
 +
{{#set: molecular weight=490.322    }}
 +
{{#set: consumed by=RXN-14570}}
 +
{{#set: reversible reaction associated=RXN-14569}}

Revision as of 14:46, 21 March 2018

Metabolite CPD-15435

  • smiles:
    • CC(O)C(C([O-])=O)NC(=O)OP(OCC3(C(C(C(N2(C1(=C(C(=NC=N1)N)N=C2)))O3)O)O))([O-])=O
  • inchi key:
    • InChIKey=GHLUPQUHEIJRCU-DWVDDHQFSA-L
  • common name:
    • L-threonylcarbamoyladenylate
  • molecular weight:
    • 490.322
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CC(O)C(C([O-])=O)NC(=O)OP(OCC3(C(C(C(N2(C1(=C(C(=NC=N1)N)N=C2)))O3)O)O))([O-])=O" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=2-PHOSPHO-4-CYTIDINE-5-DIPHOSPHO-2-C-MET&oldid=21416"