Difference between revisions of "3.4.11.4-RXN"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Donor-H2 Donor-H2] == * common name: ** an reduced unknown electron acceptor * Synonym(s): ** a...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11740 CPD-11740] == * smiles: ** C(P(C([O-])=O)([O-])=O)C(=O)C(=O)[O-] * inchi key: ** InCh...")
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Donor-H2 Donor-H2] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11740 CPD-11740] ==
 +
* smiles:
 +
** C(P(C([O-])=O)([O-])=O)C(=O)C(=O)[O-]
 +
* inchi key:
 +
** InChIKey=YTKWPNBYPYOWCP-UHFFFAOYSA-K
 
* common name:
 
* common name:
−
** an reduced unknown electron acceptor
+
** carboxyphosphinopyruvate
 +
* molecular weight:
 +
** 193.029   
 
* Synonym(s):
 
* Synonym(s):
−
** a reduced unknown electron donor
 
−
** A(H2)
 
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
−
* [[RXN0-5063]]
+
* [[RXN-10828]]
−
* [[RXN-12473]]
+
−
* [[DEOXYHYPUSINE-MONOOXYGENASE-RXN]]
+
−
* [[RXN0-2023]]
+
−
* [[R07063]]
+
−
* [[RXN-8667]]
+
−
* [[RXN-13445]]
+
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
−
* [[RXN-10981]]
+
* [[RXN-10827]]
−
* [[THIOREDOXIN-RXN]]
+
−
* [[RXN-6081]]
+
−
* [[RXN-14642]]
+
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
−
* [[RXN-13682]]
 
−
* [[NADH-DEHYDROGENASE-RXN]]
 
−
* [[ADENYLYLSULFATE-REDUCTASE-RXN]]
 
−
* [[CHD-RXN]]
 
−
* [[R07861]]
 
−
* [[RXN-14480]]
 
−
* [[RXN-10851]]
 
−
* [[RXN-11334]]
 
 
== External links  ==
 
== External links  ==
−
{{#set: common name=an reduced unknown electron acceptor}}
+
* PUBCHEM:
−
{{#set: common name=a reduced unknown electron donor|A(H2)}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=45479707 45479707]
−
{{#set: consumed by=RXN0-5063|RXN-12473|DEOXYHYPUSINE-MONOOXYGENASE-RXN|RXN0-2023|R07063|RXN-8667|RXN-13445}}
+
{{#set: smiles=C(P(C([O-])=O)([O-])=O)C(=O)C(=O)[O-]}}
−
{{#set: produced by=RXN-10981|THIOREDOXIN-RXN|RXN-6081|RXN-14642}}
+
{{#set: inchi key=InChIKey=YTKWPNBYPYOWCP-UHFFFAOYSA-K}}
−
{{#set: reversible reaction associated=RXN-13682|NADH-DEHYDROGENASE-RXN|ADENYLYLSULFATE-REDUCTASE-RXN|CHD-RXN|R07861|RXN-14480|RXN-10851|RXN-11334}}
+
{{#set: common name=carboxyphosphinopyruvate}}
 +
{{#set: molecular weight=193.029    }}
 +
{{#set: consumed by=RXN-10828}}
 +
{{#set: produced by=RXN-10827}}

Revision as of 13:47, 21 March 2018

Metabolite CPD-11740

  • smiles:
    • C(P(C([O-])=O)([O-])=O)C(=O)C(=O)[O-]
  • inchi key:
    • InChIKey=YTKWPNBYPYOWCP-UHFFFAOYSA-K
  • common name:
    • carboxyphosphinopyruvate
  • molecular weight:
    • 193.029
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C(P(C([O-])=O)([O-])=O)C(=O)C(=O)[O-" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=3.4.11.4-RXN&oldid=21673"