Difference between revisions of "GLUTAMATE-1-SEMIALDEHYDE"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=P-AMINO-BENZOATE P-AMINO-BENZOATE] == * smiles: ** C(=O)([O-])C1(C=CC(=CC=1)N) * inchi key: **...") |
(Created page with "Category:Gene == Gene Ec-10_001380 == * left end position: ** 1488712 * transcription direction: ** POSITIVE * right end position: ** 1490288 * centisome position: ** 22.8...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Ec-10_001380 == |
− | * | + | * left end position: |
− | ** | + | ** 1488712 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
− | * | + | * right end position: |
− | ** | + | ** 1490288 |
− | * | + | * centisome position: |
− | ** | + | ** 22.899792 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** Esi_0073_0112 |
− | ** | + | ** Esi0073_0112 |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | == | + | == Reactions associated == |
− | * [[ | + | * Reaction: [[NADH-DEHYDROG-A-RXN]] |
− | + | ** Source: [[annotation-esiliculosus_genome]] | |
− | == | + | *** Assignment: automated-name-match |
− | * [[ | + | == Pathways associated == |
+ | * [[PWY-6692]] | ||
+ | * [[PWY-3781]] | ||
+ | * [[PWY-5083]] | ||
+ | * [[PWY0-1335]] | ||
+ | * [[PWY0-1334]] | ||
+ | * [[PWY-4302]] | ||
== External links == | == External links == | ||
− | + | {{#set: left end position=1488712}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | + | {{#set: right end position=1490288}} | |
− | + | {{#set: centisome position=22.899792 }} | |
− | + | {{#set: common name=Esi_0073_0112|Esi0073_0112}} | |
− | + | {{#set: reaction associated=NADH-DEHYDROG-A-RXN}} | |
− | + | {{#set: pathway associated=PWY-6692|PWY-3781|PWY-5083|PWY0-1335|PWY0-1334|PWY-4302}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | {{#set: | + |
Revision as of 14:48, 21 March 2018
Gene Ec-10_001380
- left end position:
- 1488712
- transcription direction:
- POSITIVE
- right end position:
- 1490288
- centisome position:
- 22.899792
- Synonym(s):
- Esi_0073_0112
- Esi0073_0112
Reactions associated
- Reaction: NADH-DEHYDROG-A-RXN
- Source: annotation-esiliculosus_genome
- Assignment: automated-name-match
- Source: annotation-esiliculosus_genome