Difference between revisions of "RXN66-281"
From metabolic_network
(Created page with "Category:Gene == Gene Ec-00_008370 == * left end position: ** 13835011 * transcription direction: ** NEGATIVE * right end position: ** 13837904 * centisome position: ** 73...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=LINAMARIN LINAMARIN] == * smiles: ** CC(C)(C#N)OC1(OC(CO)C(O)C(O)C(O)1) * inchi key: ** InChIKe...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=LINAMARIN LINAMARIN] == |
| − | * | + | * smiles: |
| − | ** | + | ** CC(C)(C#N)OC1(OC(CO)C(O)C(O)C(O)1) |
| − | * | + | * inchi key: |
| − | ** | + | ** InChIKey=QLTCHMYAEJEXBT-ZEBDFXRSSA-N |
| − | * | + | * common name: |
| − | ** | + | ** linamarin |
| − | * | + | * molecular weight: |
| − | ** | + | ** 247.247 |
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** 2-(β-D-glucopyranosyloxy)-2-methylpropanenitrile |
| − | ** | + | ** 1-cyano-1-methylethyl beta-D-glucoside |
| − | + | ||
| − | == | + | == Reaction(s) known to consume the compound == |
| − | * [[ | + | * [[RXN-5341]] |
| − | + | == Reaction(s) known to produce the compound == | |
| − | + | * [[RXN-13602]] | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | + | ||
| − | + | ||
| − | * [[RXN- | + | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | == | + | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
== External links == | == External links == | ||
| − | {{#set: | + | * CAS : 554-35-8 |
| − | {{#set: | + | * PUBCHEM: |
| − | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=11128 11128] |
| − | {{#set: | + | * HMDB : HMDB33699 |
| − | {{#set: common name= | + | * LIGAND-CPD: |
| − | {{#set: | + | ** [http://www.genome.jp/dbget-bin/www_bget?C01594 C01594] |
| − | {{#set: | + | * CHEMSPIDER: |
| + | ** [http://www.chemspider.com/Chemical-Structure.10657.html 10657] | ||
| + | * CHEBI: | ||
| + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=16441 16441] | ||
| + | {{#set: smiles=CC(C)(C#N)OC1(OC(CO)C(O)C(O)C(O)1)}} | ||
| + | {{#set: inchi key=InChIKey=QLTCHMYAEJEXBT-ZEBDFXRSSA-N}} | ||
| + | {{#set: common name=linamarin}} | ||
| + | {{#set: molecular weight=247.247 }} | ||
| + | {{#set: common name=2-(β-D-glucopyranosyloxy)-2-methylpropanenitrile|1-cyano-1-methylethyl beta-D-glucoside}} | ||
| + | {{#set: consumed by=RXN-5341}} | ||
| + | {{#set: produced by=RXN-13602}} | ||
Revision as of 14:48, 21 March 2018
Contents
Metabolite LINAMARIN
- smiles:
- CC(C)(C#N)OC1(OC(CO)C(O)C(O)C(O)1)
- inchi key:
- InChIKey=QLTCHMYAEJEXBT-ZEBDFXRSSA-N
- common name:
- linamarin
- molecular weight:
- 247.247
- Synonym(s):
- 2-(β-D-glucopyranosyloxy)-2-methylpropanenitrile
- 1-cyano-1-methylethyl beta-D-glucoside
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
