Difference between revisions of "Ec-18 004480"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19144 CPD-19144] == * smiles: ** CCCCCCCCC=CCCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(O...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=ExchangeSeed_CA+2 ExchangeSeed_CA+2] == * direction: ** REVERSIBLE * Synonym(s): == Reaction Formu...")
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Reaction]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19144 CPD-19144] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=ExchangeSeed_CA+2 ExchangeSeed_CA+2] ==
* smiles:
+
* direction:
** CCCCCCCCC=CCCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
+
** REVERSIBLE
* inchi key:
+
** InChIKey=MJWMOLDKMBISOB-YDGGZUKGSA-J
+
* common name:
+
** (7Z)-hexadecenoyl-CoA
+
* molecular weight:
+
** 999.899   
+
 
* Synonym(s):
 
* Synonym(s):
** cis-hexadec-7-enoyl-CoA
 
** (7Z)-hexadec-7-enoyl-CoA
 
** 16:1 cis-7
 
** 16:1(n-9)
 
  
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
* [[RXN-17779]]
+
* With identifiers:
== Reaction(s) known to produce the compound ==
+
** 1.0 [[CA+2]][C-BOUNDARY] '''<=>''' 1.0 [[CA+2]][e]
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 1.0 Ca2+[C-BOUNDARY] '''<=>''' 1.0 Ca2+[e]
 +
 
 +
== Genes associated with this reaction  ==
 +
== Pathways  ==
 +
== Reconstruction information  ==
 +
* Category: [[manual]]
 +
** Source: [[manual-import_from_medium]]
 +
*** Comment: [[added to manage seeds from boundary to extracellular compartment]]
 
== External links  ==
 
== External links  ==
{{#set: smiles=CCCCCCCCC=CCCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
+
{{#set: direction=REVERSIBLE}}
{{#set: inchi key=InChIKey=MJWMOLDKMBISOB-YDGGZUKGSA-J}}
+
{{#set: in pathway=}}
{{#set: common name=(7Z)-hexadecenoyl-CoA}}
+
{{#set: reconstruction category=manual}}
{{#set: molecular weight=999.899    }}
+
{{#set: reconstruction source=manual-import_from_medium}}
{{#set: common name=cis-hexadec-7-enoyl-CoA|(7Z)-hexadec-7-enoyl-CoA|16:1 cis-7|16:1(n-9)}}
+
{{#set: reconstruction comment=added to manage seeds from boundary to extracellular compartment}}
{{#set: consumed by=RXN-17779}}
+

Revision as of 14:48, 21 March 2018

Reaction ExchangeSeed_CA+2

  • direction:
    • REVERSIBLE
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1.0 Ca2+[C-BOUNDARY] <=> 1.0 Ca2+[e]

Genes associated with this reaction

Pathways

Reconstruction information

External links