Difference between revisions of "Ec-12 006450"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PHE PHE] == * smiles: ** C([O-])(=O)C([N+])CC1(C=CC=CC=1) * inchi key: ** InChIKey=COLNVLDHVKWL...") |
(Created page with "Category:Gene == Gene Ec-01_010970 == * left end position: ** 9186467 * transcription direction: ** POSITIVE * right end position: ** 9194063 * centisome position: ** 89.0...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Ec-01_010970 == |
− | * | + | * left end position: |
− | ** | + | ** 9186467 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
− | * | + | * right end position: |
− | ** | + | ** 9194063 |
− | * | + | * centisome position: |
− | ** | + | ** 89.026215 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** Esi_0008_0217 |
− | ** | + | ** Esi0008_0217 |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | == | + | == Reactions associated == |
− | * [[ | + | * Reaction: [[ACETYL-COA-CARBOXYLTRANSFER-RXN]] |
− | * [[ | + | ** Source: [[orthology-aragem]] |
− | * [[ | + | ** Source: [[orthology-aragem]] |
− | + | * Reaction: [[PROPIONYL-COA-CARBOXY-RXN]] | |
− | == | + | ** Source: [[annotation-esiliculosus_genome]] |
− | * [[ | + | *** Assignment: ec-number |
− | * [[ | + | * Reaction: [[RXN1G-4355]] |
− | * [[ | + | ** Source: [[annotation-esiliculosus_genome]] |
+ | *** Assignment: ec-number | ||
+ | == Pathways associated == | ||
+ | * [[PWY-7388]] | ||
+ | * [[PWY-5789]] | ||
+ | * [[PWY-7384]] | ||
+ | * [[PWY-5743]] | ||
+ | * [[PWYG-321]] | ||
+ | * [[PWY-5744]] | ||
+ | * [[PWY-6728]] | ||
+ | * [[PROPIONMET-PWY]] | ||
+ | * [[PWY-6722]] | ||
+ | * [[PWY-6679]] | ||
+ | * [[PWY-4381]] | ||
== External links == | == External links == | ||
− | + | {{#set: left end position=9186467}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | + | {{#set: right end position=9194063}} | |
− | + | {{#set: centisome position=89.026215 }} | |
− | + | {{#set: common name=Esi_0008_0217|Esi0008_0217}} | |
− | + | {{#set: reaction associated=ACETYL-COA-CARBOXYLTRANSFER-RXN|PROPIONYL-COA-CARBOXY-RXN|RXN1G-4355}} | |
− | + | {{#set: pathway associated=PWY-7388|PWY-5789|PWY-7384|PWY-5743|PWYG-321|PWY-5744|PWY-6728|PROPIONMET-PWY|PWY-6722|PWY-6679|PWY-4381}} | |
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | {{#set: | + |
Revision as of 14:48, 21 March 2018
Gene Ec-01_010970
- left end position:
- 9186467
- transcription direction:
- POSITIVE
- right end position:
- 9194063
- centisome position:
- 89.026215
- Synonym(s):
- Esi_0008_0217
- Esi0008_0217
Reactions associated
- Reaction: ACETYL-COA-CARBOXYLTRANSFER-RXN
- Source: orthology-aragem
- Source: orthology-aragem
- Reaction: PROPIONYL-COA-CARBOXY-RXN
- Source: annotation-esiliculosus_genome
- Assignment: ec-number
- Source: annotation-esiliculosus_genome
- Reaction: RXN1G-4355
- Source: annotation-esiliculosus_genome
- Assignment: ec-number
- Source: annotation-esiliculosus_genome
Pathways associated
- PWY-7388
- PWY-5789
- PWY-7384
- PWY-5743
- PWYG-321
- PWY-5744
- PWY-6728
- PROPIONMET-PWY
- PWY-6722
- PWY-6679
- PWY-4381