Difference between revisions of "FOLYLPOLYGLUTAMATESYNTH-RXN"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=5-P-BETA-D-RIBOSYL-AMINE 5-P-BETA-D-RIBOSYL-AMINE] == * smiles: ** C(OP([O-])(=O)[O-])C1(C(O)C(...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-17790 RXN-17790] == * direction: ** LEFT-TO-RIGHT * common name: ** 6-phosphogluconate dehydrog...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=5-P-BETA-D-RIBOSYL-AMINE 5-P-BETA-D-RIBOSYL-AMINE] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-17790 RXN-17790] ==
−
* smiles:
+
* direction:
−
** C(OP([O-])(=O)[O-])C1(C(O)C(O)C([N+])O1)
+
** LEFT-TO-RIGHT
−
* inchi key:
+
−
** InChIKey=SKCBPEVYGOQGJN-TXICZTDVSA-M
+
 
* common name:
 
* common name:
−
** 5-phospho-β-D-ribosylamine
+
** 6-phosphogluconate dehydrogenase, C-terminal-like
−
* molecular weight:
+
** 3-hydroxyacyl-CoA dehydrogenase
−
** 228.118   
+
* ec number:
 +
** [http://enzyme.expasy.org/EC/1.1.1.35 EC-1.1.1.35]
 
* Synonym(s):
 
* Synonym(s):
−
** 5-P-β-D-ribosylamine
 
−
** PRA
 
−
** 5-phosphoribosylamine
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[GLYRIBONUCSYN-RXN]]
+
* With identifiers:
−
== Reaction(s) known to produce the compound ==
+
** 1 [[NAD]][c] '''+''' 1 [[CPD-19155]][c] '''=>''' 1 [[CPD-19158]][c] '''+''' 1 [[PROTON]][c] '''+''' 1 [[NADH]][c]
−
== Reaction(s) of unknown directionality ==
+
* With common name(s):
−
* [[PRPPAMIDOTRANS-RXN]]
+
** 1 NAD+[c] '''+''' 1 (S)-3-hydroxy-(9Z)-hexadecenoyl-CoA[c] '''=>''' 1 3-oxo-(9Z)-hexadecenoyl-CoA[c] '''+''' 1 H+[c] '''+''' 1 NADH[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Ec-14_006530]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: GO-TERM
 +
* Gene: [[Ec-19_005290]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: EC-NUMBER
 +
== Pathways  ==
 +
== Reconstruction information  ==
 +
* Category: [[annotation]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
−
* BIGG : 41182
+
{{#set: direction=LEFT-TO-RIGHT}}
−
* PUBCHEM:
+
{{#set: common name=6-phosphogluconate dehydrogenase, C-terminal-like}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=45266724 45266724]
+
{{#set: common name=3-hydroxyacyl-CoA dehydrogenase}}
−
* HMDB : HMDB01128
+
{{#set: ec number=EC-1.1.1.35}}
−
* LIGAND-CPD:
+
{{#set: gene associated=Ec-14_006530|Ec-19_005290}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C03090 C03090]
+
{{#set: in pathway=}}
−
* CHEBI:
+
{{#set: reconstruction category=annotation}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58681 58681]
+
{{#set: reconstruction source=annotation-esiliculosus_genome}}
−
* METABOLIGHTS : MTBLC58681
+
{{#set: reconstruction tool=pathwaytools}}
−
{{#set: smiles=C(OP([O-])(=O)[O-])C1(C(O)C(O)C([N+])O1)}}
+
−
{{#set: inchi key=InChIKey=SKCBPEVYGOQGJN-TXICZTDVSA-M}}
+
−
{{#set: common name=5-phospho-β-D-ribosylamine}}
+
−
{{#set: molecular weight=228.118    }}
+
−
{{#set: common name=5-P-β-D-ribosylamine|PRA|5-phosphoribosylamine}}
+
−
{{#set: consumed by=GLYRIBONUCSYN-RXN}}
+
−
{{#set: reversible reaction associated=PRPPAMIDOTRANS-RXN}}
+

Revision as of 14:48, 21 March 2018

Reaction RXN-17790

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • 6-phosphogluconate dehydrogenase, C-terminal-like
    • 3-hydroxyacyl-CoA dehydrogenase
  • ec number:
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1 NAD+[c] + 1 (S)-3-hydroxy-(9Z)-hexadecenoyl-CoA[c] => 1 3-oxo-(9Z)-hexadecenoyl-CoA[c] + 1 H+[c] + 1 NADH[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

Reconstruction information

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=FOLYLPOLYGLUTAMATESYNTH-RXN&oldid=21848"