Difference between revisions of "RXN0-5222"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PYRIDOXINE-5P PYRIDOXINE-5P] == * smiles: ** CC1(=NC=C(COP([O-])(=O)[O-])C(=C(O)1)CO) * inchi k...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GLUCONATE GLUCONATE] == * smiles: ** C(O)C(O)C(O)C(O)C(O)C(=O)[O-] * inchi key: ** InChIKey=RGH...") |
||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GLUCONATE GLUCONATE] == |
* smiles: | * smiles: | ||
| − | ** | + | ** C(O)C(O)C(O)C(O)C(O)C(=O)[O-] |
* inchi key: | * inchi key: | ||
| − | ** InChIKey= | + | ** InChIKey=RGHNJXZEOKUKBD-SQOUGZDYSA-M |
* common name: | * common name: | ||
| − | ** | + | ** D-gluconate |
* molecular weight: | * molecular weight: | ||
| − | ** | + | ** 195.149 |
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** D-gluconic acid |
| − | ** | + | ** dextronic acid |
| − | ** | + | ** maltonic acid |
| − | + | ||
| − | + | ||
| − | + | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[GLUCONOLACT-RXN]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
| − | * CAS : | + | * CAS : 526-95-4 |
| − | * BIGG : | + | * BIGG : 34420 |
* PUBCHEM: | * PUBCHEM: | ||
| − | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=6419706 6419706] |
| − | * HMDB : | + | * HMDB : HMDB00625 |
* LIGAND-CPD: | * LIGAND-CPD: | ||
| − | ** [http://www.genome.jp/dbget-bin/www_bget? | + | ** [http://www.genome.jp/dbget-bin/www_bget?C00257 C00257] |
| + | * CHEMSPIDER: | ||
| + | ** [http://www.chemspider.com/Chemical-Structure.4925340.html 4925340] | ||
* CHEBI: | * CHEBI: | ||
| − | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=18391 18391] |
| − | * METABOLIGHTS : | + | * METABOLIGHTS : MTBLC18391 |
| − | {{#set: smiles= | + | {{#set: smiles=C(O)C(O)C(O)C(O)C(O)C(=O)[O-]}} |
| − | {{#set: inchi key=InChIKey= | + | {{#set: inchi key=InChIKey=RGHNJXZEOKUKBD-SQOUGZDYSA-M}} |
| − | {{#set: common name= | + | {{#set: common name=D-gluconate}} |
| − | {{#set: molecular weight= | + | {{#set: molecular weight=195.149 }} |
| − | {{#set: common name= | + | {{#set: common name=D-gluconic acid|dextronic acid|maltonic acid}} |
| − | + | {{#set: produced by=GLUCONOLACT-RXN}} | |
| − | {{#set: produced by= | + | |
Revision as of 14:49, 21 March 2018
Contents
Metabolite GLUCONATE
- smiles:
- C(O)C(O)C(O)C(O)C(O)C(=O)[O-]
- inchi key:
- InChIKey=RGHNJXZEOKUKBD-SQOUGZDYSA-M
- common name:
- D-gluconate
- molecular weight:
- 195.149
- Synonym(s):
- D-gluconic acid
- dextronic acid
- maltonic acid
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- CAS : 526-95-4
- BIGG : 34420
- PUBCHEM:
- HMDB : HMDB00625
- LIGAND-CPD:
- CHEMSPIDER:
- CHEBI:
- METABOLIGHTS : MTBLC18391
"C(O)C(O)C(O)C(O)C(O)C(=O)[O-" cannot be used as a page name in this wiki.
