Difference between revisions of "RXN-1102"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DETHIOBIOTIN DETHIOBIOTIN] == * smiles: ** CC1(NC(=O)NC1CCCCCC(=O)[O-]) * inchi key: ** InChIKe...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-15816 RXN-15816] == * direction: ** LEFT-TO-RIGHT * common name: ** Cytochrome c1 ** ubiquinol...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-15816 RXN-15816] == |
− | * | + | * direction: |
− | ** | + | ** LEFT-TO-RIGHT |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** Cytochrome c1 |
− | * | + | ** ubiquinol cytochrome c reductase subunit QCR9 |
− | ** | + | ** Ubiquinol cytochrome reductase, transmembrane domain |
+ | ** Ubiquinol-cytochrome C reductase hinge domain | ||
+ | ** Cytochrome b-c1 complex subunit 7 | ||
+ | * ec number: | ||
+ | ** [http://enzyme.expasy.org/EC/1.10.2.2 EC-1.10.2.2] | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | == Reaction | + | == Reaction Formula == |
− | * [[2 | + | * With identifiers: |
− | + | ** 1 [[ETR-Quinols]][c] '''+''' 2 [[Cytochromes-C-Oxidized]][e] '''=>''' 2 [[Cytochromes-C-Reduced]][e] '''+''' 2 [[PROTON]][c] '''+''' 1 [[ETR-Quinones]][c] | |
− | * [[ | + | * With common name(s): |
− | == | + | ** 1 an electron-transfer quinol[c] '''+''' 2 an oxidized c-type cytochrome[e] '''=>''' 2 a reduced c-type cytochrome[e] '''+''' 2 H+[c] '''+''' 1 an electron-transfer quinone[c] |
− | * [[ | + | |
+ | == Genes associated with this reaction == | ||
+ | Genes have been associated with this reaction based on different elements listed below. | ||
+ | * Gene: [[Ec-21_004500]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Assignment: EC-NUMBER | ||
+ | * Gene: [[Ec-18_002810]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Assignment: EC-NUMBER | ||
+ | * Gene: [[Ec-08_003040]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Assignment: EC-NUMBER | ||
+ | * Gene: [[Ec-25_001440]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Assignment: EC-NUMBER | ||
+ | * Gene: [[Ec-01_002540]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Assignment: EC-NUMBER | ||
+ | == Pathways == | ||
+ | == Reconstruction information == | ||
+ | * Category: [[annotation]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Tool: [[pathwaytools]] | ||
== External links == | == External links == | ||
− | + | {{#set: direction=LEFT-TO-RIGHT}} | |
− | + | {{#set: common name=Cytochrome c1}} | |
− | + | {{#set: common name=ubiquinol cytochrome c reductase subunit QCR9}} | |
− | + | {{#set: common name=Ubiquinol cytochrome reductase, transmembrane domain}} | |
− | + | {{#set: common name=Ubiquinol-cytochrome C reductase hinge domain}} | |
− | + | {{#set: common name=Cytochrome b-c1 complex subunit 7}} | |
− | + | {{#set: ec number=EC-1.10.2.2}} | |
− | + | {{#set: gene associated=Ec-21_004500|Ec-18_002810|Ec-08_003040|Ec-25_001440|Ec-01_002540}} | |
− | + | {{#set: in pathway=}} | |
− | {{#set: | + | {{#set: reconstruction category=annotation}} |
− | {{#set: | + | {{#set: reconstruction source=annotation-esiliculosus_genome}} |
− | {{#set: common name= | + | {{#set: reconstruction tool=pathwaytools}} |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Revision as of 13:49, 21 March 2018
Contents
Reaction RXN-15816
- direction:
- LEFT-TO-RIGHT
- common name:
- Cytochrome c1
- ubiquinol cytochrome c reductase subunit QCR9
- Ubiquinol cytochrome reductase, transmembrane domain
- Ubiquinol-cytochrome C reductase hinge domain
- Cytochrome b-c1 complex subunit 7
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 ETR-Quinols[c] + 2 Cytochromes-C-Oxidized[e] => 2 Cytochromes-C-Reduced[e] + 2 PROTON[c] + 1 ETR-Quinones[c]
- With common name(s):
- 1 an electron-transfer quinol[c] + 2 an oxidized c-type cytochrome[e] => 2 a reduced c-type cytochrome[e] + 2 H+[c] + 1 an electron-transfer quinone[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Ec-21_004500
- Source: annotation-esiliculosus_genome
- Assignment: EC-NUMBER
- Source: annotation-esiliculosus_genome
- Gene: Ec-18_002810
- Source: annotation-esiliculosus_genome
- Assignment: EC-NUMBER
- Source: annotation-esiliculosus_genome
- Gene: Ec-08_003040
- Source: annotation-esiliculosus_genome
- Assignment: EC-NUMBER
- Source: annotation-esiliculosus_genome
- Gene: Ec-25_001440
- Source: annotation-esiliculosus_genome
- Assignment: EC-NUMBER
- Source: annotation-esiliculosus_genome
- Gene: Ec-01_002540
- Source: annotation-esiliculosus_genome
- Assignment: EC-NUMBER
- Source: annotation-esiliculosus_genome
Pathways
Reconstruction information
- Category: annotation
- Source: annotation-esiliculosus_genome
- Tool: pathwaytools
- Source: annotation-esiliculosus_genome