Difference between revisions of "RXN-17786"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PANTOTHENATE PANTOTHENATE] == * smiles: ** CC(C)(CO)C(O)C(=O)NCCC(=O)[O-] * inchi key: ** InChI...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14515 RXN-14515] == * direction: ** LEFT-TO-RIGHT * Synonym(s): == Reaction Formula == * With...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Reaction]] |
| − | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14515 RXN-14515] == |
| − | * | + | * direction: |
| − | ** | + | ** LEFT-TO-RIGHT |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | |||
| − | |||
| − | == Reaction | + | == Reaction Formula == |
| − | * [[ | + | * With identifiers: |
| − | + | ** 1 [[CPD-15382]][c] '''=>''' 1 [[BETA-D-FRUCTOSE]][c] | |
| − | * [[ | + | * With common name(s): |
| − | == | + | ** 1 keto-D-fructose[c] '''=>''' 1 β-D-fructofuranose[c] |
| + | |||
| + | == Genes associated with this reaction == | ||
| + | == Pathways == | ||
| + | * [[PWY-4101]], D-sorbitol degradation I: [http://metacyc.org/META/NEW-IMAGE?object=PWY-4101 PWY-4101] | ||
| + | ** '''3''' reactions found over '''3''' reactions in the full pathway | ||
| + | * [[PWY-6531]], mannitol cycle: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6531 PWY-6531] | ||
| + | ** '''4''' reactions found over '''5''' reactions in the full pathway | ||
| + | == Reconstruction information == | ||
| + | * Category: [[annotation]] | ||
| + | ** Source: [[annotation-esiliculosus_genome]] | ||
| + | *** Tool: [[pathwaytools]] | ||
== External links == | == External links == | ||
| − | + | {{#set: direction=LEFT-TO-RIGHT}} | |
| − | + | {{#set: in pathway=PWY-4101|PWY-6531}} | |
| − | + | {{#set: reconstruction category=annotation}} | |
| − | + | {{#set: reconstruction source=annotation-esiliculosus_genome}} | |
| − | + | {{#set: reconstruction tool=pathwaytools}} | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | + | ||
| − | {{#set: | + | |
| − | + | ||
Revision as of 14:49, 21 March 2018
Contents
Reaction RXN-14515
- direction:
- LEFT-TO-RIGHT
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 CPD-15382[c] => 1 BETA-D-FRUCTOSE[c]
- With common name(s):
- 1 keto-D-fructose[c] => 1 β-D-fructofuranose[c]
Genes associated with this reaction
Pathways
- PWY-4101, D-sorbitol degradation I: PWY-4101
- 3 reactions found over 3 reactions in the full pathway
- PWY-6531, mannitol cycle: PWY-6531
- 4 reactions found over 5 reactions in the full pathway
Reconstruction information
- Category: annotation
- Source: annotation-esiliculosus_genome
- Tool: pathwaytools
- Source: annotation-esiliculosus_genome
