Difference between revisions of "ENOYL-COA-DELTA-ISOM-RXN"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-16817 CPD-16817] == * smiles: ** C2(C=CC1(=C(C(OS([O-])(=O)=O)=CN1)C=2)) * inchi key: ** In...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=7Z-3-oxo-hexadec-7-enoyl-ACPs 7Z-3-oxo-hexadec-7-enoyl-ACPs] == * common name: ** a (7Z)-3-oxo-...")
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-16817 CPD-16817] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=7Z-3-oxo-hexadec-7-enoyl-ACPs 7Z-3-oxo-hexadec-7-enoyl-ACPs] ==
* smiles:
+
** C2(C=CC1(=C(C(OS([O-])(=O)=O)=CN1)C=2))
+
* inchi key:
+
** InChIKey=BXFFHSIDQOFMLE-UHFFFAOYSA-M
+
 
* common name:
 
* common name:
** indoxyl sulfate
+
** a (7Z)-3-oxo-hexadec-7-enoyl-[acp]
* molecular weight:
+
** 212.2   
+
 
* Synonym(s):
 
* Synonym(s):
** indol-3-yl sulfate
 
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN-16622]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN-16621]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
* [[RXN-15587]]
 
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: common name=a (7Z)-3-oxo-hexadec-7-enoyl-[acp]}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=4453098 4453098]
+
{{#set: consumed by=RXN-16622}}
* CHEBI:
+
{{#set: produced by=RXN-16621}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=43355 43355]
+
* HMDB : HMDB00682
+
{{#set: smiles=C2(C=CC1(=C(C(OS([O-])(=O)=O)=CN1)C=2))}}
+
{{#set: inchi key=InChIKey=BXFFHSIDQOFMLE-UHFFFAOYSA-M}}
+
{{#set: common name=indoxyl sulfate}}
+
{{#set: molecular weight=212.2    }}
+
{{#set: common name=indol-3-yl sulfate}}
+
{{#set: reversible reaction associated=RXN-15587}}
+

Revision as of 14:50, 21 March 2018

Metabolite 7Z-3-oxo-hexadec-7-enoyl-ACPs

  • common name:
    • a (7Z)-3-oxo-hexadec-7-enoyl-[acp]
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"a (7Z)-3-oxo-hexadec-7-enoyl-[acp" cannot be used as a page name in this wiki.