Difference between revisions of "RXN-14883"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-641 CPD-641] == * smiles: ** CC(O)(CCOP(=O)([O-])OP([O-])([O-])=O)CC(=O)[O-] * inchi key: *...") |
(Created page with "Category:Gene == Gene Ec-02_004960 == * left end position: ** 5265622 * transcription direction: ** POSITIVE * right end position: ** 5268339 * centisome position: ** 80.6...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Ec-02_004960 == |
− | * | + | * left end position: |
− | ** | + | ** 5265622 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
− | * | + | * right end position: |
− | ** | + | ** 5268339 |
− | * | + | * centisome position: |
− | ** | + | ** 80.66468 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** Esi_0024_0099 |
− | ** | + | ** Esi0024_0099 |
+ | ** 6PGL | ||
− | == | + | == Reactions associated == |
− | * [[ | + | * Reaction: [[6PGLUCONOLACT-RXN]] |
− | + | ** Source: [[annotation-esiliculosus_genome]] | |
− | == | + | *** Assignment: ec-number |
− | * [[ | + | ** Source: [[orthology-aragem]] |
+ | ** Source: [[orthology-aragem]] | ||
+ | == Pathways associated == | ||
+ | * [[P122-PWY]] | ||
+ | * [[RUMP-PWY]] | ||
+ | * [[OXIDATIVEPENT-PWY]] | ||
+ | * [[GLYCOLYSIS-E-D]] | ||
== External links == | == External links == | ||
− | + | {{#set: left end position=5265622}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | + | {{#set: right end position=5268339}} | |
− | + | {{#set: centisome position=80.66468 }} | |
− | + | {{#set: common name=Esi_0024_0099|Esi0024_0099|6PGL}} | |
− | + | {{#set: reaction associated=6PGLUCONOLACT-RXN}} | |
− | + | {{#set: pathway associated=P122-PWY|RUMP-PWY|OXIDATIVEPENT-PWY|GLYCOLYSIS-E-D}} | |
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | {{#set: | + |
Revision as of 13:50, 21 March 2018
Gene Ec-02_004960
- left end position:
- 5265622
- transcription direction:
- POSITIVE
- right end position:
- 5268339
- centisome position:
- 80.66468
- Synonym(s):
- Esi_0024_0099
- Esi0024_0099
- 6PGL
Reactions associated
- Reaction: 6PGLUCONOLACT-RXN
- Source: annotation-esiliculosus_genome
- Assignment: ec-number
- Source: orthology-aragem
- Source: orthology-aragem
- Source: annotation-esiliculosus_genome