Difference between revisions of "Ec-01 002250"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14901 CPD-14901] == * smiles: ** CCC(C(C)C)CCC(C)[CH]3(CC[CH]4(C2(=CC[CH]1(CC(O)CCC(C)1[CH]...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4201 CPD-4201] == * smiles: ** CC(=CCNC3(=NC=NC2(N(C1(C(C(C(O1)COP(OP(=O)([O-])OP(=O)([O-])...") |
||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD- | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4201 CPD-4201] == |
* smiles: | * smiles: | ||
− | ** | + | ** CC(=CCNC3(=NC=NC2(N(C1(C(C(C(O1)COP(OP(=O)([O-])OP(=O)([O-])O)([O-])=O)O)O))C=NC=23)))C |
* inchi key: | * inchi key: | ||
− | ** InChIKey= | + | ** InChIKey=OPLVZTYVQUWKHB-SDBHATRESA-K |
* common name: | * common name: | ||
− | ** | + | ** N6-(Δ2-isopentenyl)-adenosine 5'-triphosphate |
* molecular weight: | * molecular weight: | ||
− | ** | + | ** 572.278 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** iPTP |
− | ** | + | ** isopentenyladenosine riboside-5'-triphosphate |
− | ** | + | ** iPRTP |
− | ** | + | ** isopentenyladenosine-5'-triphosphate |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
+ | * [[RXN-4303]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
− | |||
* PUBCHEM: | * PUBCHEM: | ||
− | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25203647 25203647] |
− | {{#set: smiles= | + | * CHEBI: |
− | {{#set: inchi key=InChIKey= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=71679 71679] |
− | {{#set: common name= | + | * LIGAND-CPD: |
− | {{#set: molecular weight= | + | ** [http://www.genome.jp/dbget-bin/www_bget?C16424 C16424] |
− | {{#set: common name= | + | {{#set: smiles=CC(=CCNC3(=NC=NC2(N(C1(C(C(C(O1)COP(OP(=O)([O-])OP(=O)([O-])O)([O-])=O)O)O))C=NC=23)))C}} |
− | {{#set: | + | {{#set: inchi key=InChIKey=OPLVZTYVQUWKHB-SDBHATRESA-K}} |
+ | {{#set: common name=N6-(Δ2-isopentenyl)-adenosine 5'-triphosphate}} | ||
+ | {{#set: molecular weight=572.278 }} | ||
+ | {{#set: common name=iPTP|isopentenyladenosine riboside-5'-triphosphate|iPRTP|isopentenyladenosine-5'-triphosphate}} | ||
+ | {{#set: produced by=RXN-4303}} |
Revision as of 13:51, 21 March 2018
Contents
Metabolite CPD-4201
- smiles:
- CC(=CCNC3(=NC=NC2(N(C1(C(C(C(O1)COP(OP(=O)([O-])OP(=O)([O-])O)([O-])=O)O)O))C=NC=23)))C
- inchi key:
- InChIKey=OPLVZTYVQUWKHB-SDBHATRESA-K
- common name:
- N6-(Δ2-isopentenyl)-adenosine 5'-triphosphate
- molecular weight:
- 572.278
- Synonym(s):
- iPTP
- isopentenyladenosine riboside-5'-triphosphate
- iPRTP
- isopentenyladenosine-5'-triphosphate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC(=CCNC3(=NC=NC2(N(C1(C(C(C(O1)COP(OP(=O)([O-])OP(=O)([O-])O)([O-])=O)O)O))C=NC=23)))C" cannot be used as a page name in this wiki.