Difference between revisions of "RXN-9524"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14594 CPD-14594] == * smiles: ** CC(OC2(OC(COC1(OC(CO)C(O)C(O)C(O)1))C(O)C(O)C(O)2))(C#N)C...")
(Created page with "Category:Gene == Gene Ec-03_002160 == * Synonym(s): ** Esi_0011_0114 ** Esi0011_0114 == Reactions associated == * Reaction: 3PGAREARR-RXN ** Source: orthology-arage...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14594 CPD-14594] ==
+
== Gene Ec-03_002160 ==
−
* smiles:
+
−
** CC(OC2(OC(COC1(OC(CO)C(O)C(O)C(O)1))C(O)C(O)C(O)2))(C#N)C
+
−
* inchi key:
+
−
** InChIKey=FERSMFQBWVBKQK-CXTTVELOSA-N
+
−
* common name:
+
−
** linustatin
+
−
* molecular weight:
+
−
** 409.389   
+
 
* Synonym(s):
 
* Synonym(s):
−
** propanenitrile
+
** Esi_0011_0114
−
** [2-(6-O-β-D-glucopyranosyl-β-D-glucopyranosyloxy)-2-methylpropiononitrile)]
+
** Esi0011_0114
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[RXN-13602]]
+
* Reaction: [[3PGAREARR-RXN]]
−
== Reaction(s) known to produce the compound ==
+
** Source: [[orthology-aragem]]
−
== Reaction(s) of unknown directionality ==
+
** Source: [[orthology-aragem]]
 +
== Pathways associated ==
 +
* [[PWY-1042]]
 +
* [[P341-PWY]]
 +
* [[PWY-2221]]
 +
* [[GLUCONEO-PWY]]
 +
* [[GLYCOLYSIS]]
 +
* [[PWY-6901]]
 +
* [[PWY-7218]]
 +
* [[P124-PWY]]
 +
* [[PWY-6886]]
 +
* [[PWY-5723]]
 +
* [[PWY-6142]]
 +
* [[PWY-5484]]
 +
* [[PWY-7124]]
 +
* [[PWY-7003]]
 
== External links  ==
 
== External links  ==
−
* LIGAND-CPD:
+
{{#set: common name=Esi_0011_0114|Esi0011_0114}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C08333 C08333]
+
{{#set: reaction associated=3PGAREARR-RXN}}
−
* CHEBI:
+
{{#set: pathway associated=PWY-1042|P341-PWY|PWY-2221|GLUCONEO-PWY|GLYCOLYSIS|PWY-6901|PWY-7218|P124-PWY|PWY-6886|PWY-5723|PWY-6142|PWY-5484|PWY-7124|PWY-7003}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=6483 6483]
+
−
* PUBCHEM:
+
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=119301 119301]
+
−
{{#set: smiles=CC(OC2(OC(COC1(OC(CO)C(O)C(O)C(O)1))C(O)C(O)C(O)2))(C#N)C}}
+
−
{{#set: inchi key=InChIKey=FERSMFQBWVBKQK-CXTTVELOSA-N}}
+
−
{{#set: common name=linustatin}}
+
−
{{#set: molecular weight=409.389    }}
+
−
{{#set: common name=propanenitrile|[2-(6-O-β-D-glucopyranosyl-β-D-glucopyranosyloxy)-2-methylpropiononitrile)]}}
+
−
{{#set: consumed by=RXN-13602}}
+

Revision as of 14:51, 21 March 2018

Gene Ec-03_002160

  • Synonym(s):
    • Esi_0011_0114
    • Esi0011_0114

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=RXN-9524&oldid=22210"