Difference between revisions of "Ubiquitin-activating-protein-E1-L-cys"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19155 CPD-19155] == * smiles: ** CCCCCCC=CCCCCCC(O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O...")
(Created page with "Category:Gene == Gene Ec-20_004950 == * left end position: ** 4967773 * transcription direction: ** NEGATIVE * right end position: ** 4971477 * centisome position: ** 96.3...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19155 CPD-19155] ==
+
== Gene Ec-20_004950 ==
−
* smiles:
+
* left end position:
−
** CCCCCCC=CCCCCCC(O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
+
** 4967773
−
* inchi key:
+
* transcription direction:
−
** InChIKey=ZIRSQPAPHGZDIL-VSCXGISKSA-J
+
** NEGATIVE
−
* common name:
+
* right end position:
−
** (S)-3-hydroxy-(9Z)-hexadecenoyl-CoA
+
** 4971477
−
* molecular weight:
+
* centisome position:
−
** 1015.898    
+
** 96.34149    
 
* Synonym(s):
 
* Synonym(s):
−
** (S)-3-hydroxy-16:1-Δ9-CoA
+
** Esi_0231_0013
−
** (S)-3-hydroxy-9-cis-hexadecenoyl-CoA
+
** Esi0231_0013
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[RXN-17790]]
+
* Reaction: [[DTMPKI-RXN]]
−
== Reaction(s) known to produce the compound ==
+
** Source: [[annotation-esiliculosus_genome]]
−
* [[RXN-17789]]
+
*** Assignment: go-term
−
== Reaction(s) of unknown directionality ==
+
== Pathways associated ==
 +
* [[PWY-7210]]
 +
* [[PWY-7198]]
 +
* [[PWY-7184]]
 +
* [[PWY-7187]]
 +
* [[PWY-7197]]
 +
* [[PWY0-166]]
 +
* [[PWY-6545]]
 
== External links  ==
 
== External links  ==
−
{{#set: smiles=CCCCCCC=CCCCCCC(O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
+
{{#set: left end position=4967773}}
−
{{#set: inchi key=InChIKey=ZIRSQPAPHGZDIL-VSCXGISKSA-J}}
+
{{#set: transcription direction=NEGATIVE}}
−
{{#set: common name=(S)-3-hydroxy-(9Z)-hexadecenoyl-CoA}}
+
{{#set: right end position=4971477}}
−
{{#set: molecular weight=1015.898   }}
+
{{#set: centisome position=96.34149   }}
−
{{#set: common name=(S)-3-hydroxy-16:1-Δ9-CoA|(S)-3-hydroxy-9-cis-hexadecenoyl-CoA}}
+
{{#set: common name=Esi_0231_0013|Esi0231_0013}}
−
{{#set: consumed by=RXN-17790}}
+
{{#set: reaction associated=DTMPKI-RXN}}
−
{{#set: produced by=RXN-17789}}
+
{{#set: pathway associated=PWY-7210|PWY-7198|PWY-7184|PWY-7187|PWY-7197|PWY0-166|PWY-6545}}

Revision as of 13:51, 21 March 2018

Gene Ec-20_004950

  • left end position:
    • 4967773
  • transcription direction:
    • NEGATIVE
  • right end position:
    • 4971477
  • centisome position:
    • 96.34149
  • Synonym(s):
    • Esi_0231_0013
    • Esi0231_0013

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Ubiquitin-activating-protein-E1-L-cys&oldid=22251"