Difference between revisions of "Double-helix-DNA"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=QUEUINE QUEUINE] == * smiles: ** C([N+]C1(C=CC(O)C(O)1))C2(=CNC3(N=C(NC(=O)C2=3)N)) * inchi key...") |
(Created page with "Category:Gene == Gene Ec-01_007940 == * left end position: ** 6784282 * transcription direction: ** NEGATIVE * right end position: ** 6787196 * centisome position: ** 65.7...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Ec-01_007940 == |
− | * | + | * left end position: |
− | ** | + | ** 6784282 |
− | * | + | * transcription direction: |
− | ** | + | ** NEGATIVE |
− | * | + | * right end position: |
− | ** | + | ** 6787196 |
− | * | + | * centisome position: |
− | ** | + | ** 65.7466 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** Esi_0002_0087 |
− | ** | + | ** Esi0002_0087 |
− | ** | + | ** DPM1 |
− | == | + | == Reactions associated == |
− | + | * Reaction: [[2.4.1.83-RXN]] | |
− | == | + | ** Source: [[annotation-esiliculosus_genome]] |
− | * [[ | + | *** Assignment: ec-number |
+ | * Reaction: [[RXN-16602]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Assignment: ec-number | ||
+ | == Pathways associated == | ||
+ | * [[PWY-7661]] | ||
+ | * [[MANNOSYL-CHITO-DOLICHOL-BIOSYNTHESIS]] | ||
== External links == | == External links == | ||
− | + | {{#set: left end position=6784282}} | |
− | + | {{#set: transcription direction=NEGATIVE}} | |
− | + | {{#set: right end position=6787196}} | |
− | + | {{#set: centisome position=65.7466 }} | |
− | + | {{#set: common name=Esi_0002_0087|Esi0002_0087|DPM1}} | |
− | {{#set: | + | {{#set: reaction associated=2.4.1.83-RXN|RXN-16602}} |
− | {{#set: | + | {{#set: pathway associated=PWY-7661|MANNOSYL-CHITO-DOLICHOL-BIOSYNTHESIS}} |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + |
Revision as of 14:51, 21 March 2018
Gene Ec-01_007940
- left end position:
- 6784282
- transcription direction:
- NEGATIVE
- right end position:
- 6787196
- centisome position:
- 65.7466
- Synonym(s):
- Esi_0002_0087
- Esi0002_0087
- DPM1
Reactions associated
- Reaction: 2.4.1.83-RXN
- Source: annotation-esiliculosus_genome
- Assignment: ec-number
- Source: annotation-esiliculosus_genome
- Reaction: RXN-16602
- Source: annotation-esiliculosus_genome
- Assignment: ec-number
- Source: annotation-esiliculosus_genome