Difference between revisions of "Ec-11 006270"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Gene == Gene Ec-06_005470 == * left end position: ** 4347324 * transcription direction: ** NEGATIVE * right end position: ** 4348532 * centisome position: ** 49.6...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11444 CPD-11444] == * smiles: ** C(=O)([O-])CCC5(=C4(NC(CC1(NC(=C(CC([O-])=O)C(CCC(=O)[O-])...")
Line 1: Line 1:
[[Category:Gene]]
+
[[Category:Metabolite]]
== Gene Ec-06_005470 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11444 CPD-11444] ==
* left end position:
+
* smiles:
** 4347324
+
** C(=O)([O-])CCC5(=C4(NC(CC1(NC(=C(CC([O-])=O)C(CCC(=O)[O-])=1)CC2(NC(=C(C(CCC(=O)[O-])=2)CC(=O)[O-])CC3(=C(CCC([O-])=O)C(CC(=O)[O-])=C(N3)C4))))=C(CC(=O)[O-])5))
* transcription direction:
+
* inchi key:
** NEGATIVE
+
** InChIKey=QTTNOSKSLATGQB-UHFFFAOYSA-F
* right end position:
+
* common name:
** 4348532
+
** uroporphyrinogen-I
* centisome position:
+
* molecular weight:
** 49.63969    
+
** 828.742    
 
* Synonym(s):
 
* Synonym(s):
** Esi_0052_0202
+
** uroporphyrinogen I
** Esi0052_0202
+
  
== Reactions associated ==
+
== Reaction(s) known to consume the compound ==
* [[ATPASE-RXN]]
+
== Reaction(s) known to produce the compound ==
** esiliculosus_genome
+
* [[RXN-14396]]
***go-term
+
== Reaction(s) of unknown directionality ==
* [[NUCLEOSIDE-TRIPHOSPHATASE-RXN]]
+
* [[RXN-10642]]
** esiliculosus_genome
+
***go-term
+
* [[RXN-12195]]
+
** esiliculosus_genome
+
***go-term
+
* [[RXN-12196]]
+
** esiliculosus_genome
+
***go-term
+
* [[RXN0-5462]]
+
** esiliculosus_genome
+
***go-term
+
== Pathways associated ==
+
* [[PWY-7184]]
+
* [[PWY-7198]]
+
* [[PWY-6545]]
+
* [[PWY-7210]]
+
 
== External links  ==
 
== External links  ==
{{#set: left end position=4347324}}
+
* PUBCHEM:
{{#set: transcription direction=NEGATIVE}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25201940 25201940]
{{#set: right end position=4348532}}
+
* CHEMSPIDER:
{{#set: centisome position=49.63969   }}
+
** [http://www.chemspider.com/Chemical-Structure.389644.html 389644]
{{#set: common name=Esi_0052_0202|Esi0052_0202}}
+
* CHEBI:
{{#set: reaction associated=ATPASE-RXN|NUCLEOSIDE-TRIPHOSPHATASE-RXN|RXN-12195|RXN-12196|RXN0-5462}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=62626 62626]
{{#set: pathway associated=PWY-7184|PWY-7198|PWY-6545|PWY-7210}}
+
* LIGAND-CPD:
 +
** [http://www.genome.jp/dbget-bin/www_bget?C05766 C05766]
 +
* HMDB : HMDB02211
 +
{{#set: smiles=C(=O)([O-])CCC5(=C4(NC(CC1(NC(=C(CC([O-])=O)C(CCC(=O)[O-])=1)CC2(NC(=C(C(CCC(=O)[O-])=2)CC(=O)[O-])CC3(=C(CCC([O-])=O)C(CC(=O)[O-])=C(N3)C4))))=C(CC(=O)[O-])5))}}
 +
{{#set: inchi key=InChIKey=QTTNOSKSLATGQB-UHFFFAOYSA-F}}
 +
{{#set: common name=uroporphyrinogen-I}}
 +
{{#set: molecular weight=828.742   }}
 +
{{#set: common name=uroporphyrinogen I}}
 +
{{#set: produced by=RXN-14396}}
 +
{{#set: reversible reaction associated=RXN-10642}}

Revision as of 14:51, 21 March 2018

Metabolite CPD-11444

  • smiles:
    • C(=O)([O-])CCC5(=C4(NC(CC1(NC(=C(CC([O-])=O)C(CCC(=O)[O-])=1)CC2(NC(=C(C(CCC(=O)[O-])=2)CC(=O)[O-])CC3(=C(CCC([O-])=O)C(CC(=O)[O-])=C(N3)C4))))=C(CC(=O)[O-])5))
  • inchi key:
    • InChIKey=QTTNOSKSLATGQB-UHFFFAOYSA-F
  • common name:
    • uroporphyrinogen-I
  • molecular weight:
    • 828.742
  • Synonym(s):
    • uroporphyrinogen I

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C(=O)([O-])CCC5(=C4(NC(CC1(NC(=C(CC([O-])=O)C(CCC(=O)[O-])=1)CC2(NC(=C(C(CCC(=O)[O-])=2)CC(=O)[O-])CC3(=C(CCC([O-])=O)C(CC(=O)[O-])=C(N3)C4))))=C(CC(=O)[O-])5))" cannot be used as a page name in this wiki.