Difference between revisions of "3.1.1.47-RXN"
From metabolic_network
(Created page with "Category:Gene == Gene Ec-14_001790 == * left end position: ** 1700816 * transcription direction: ** POSITIVE * right end position: ** 1703722 * centisome position: ** 25.9...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DMPBQ DMPBQ] == * smiles: ** CC(CCCC(CCCC(C)CCCC(C)=CCC1(C=C(C(C)=C(C)C=1O)O))C)C * inchi key:...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DMPBQ DMPBQ] == |
− | * | + | * smiles: |
− | ** | + | ** CC(CCCC(CCCC(C)CCCC(C)=CCC1(C=C(C(C)=C(C)C=1O)O))C)C |
− | * | + | * inchi key: |
− | ** | + | ** InChIKey=SUFZKUBNOVDJRR-WGEODTKDSA-N |
− | * | + | * common name: |
− | ** | + | ** 2,3-dimethyl-6-phytyl-1,4-benzoquinol |
− | * | + | * molecular weight: |
− | ** | + | ** 416.686 |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | == | + | == Reaction(s) known to consume the compound == |
− | * [[ | + | * [[RXN-2543]] |
− | + | == Reaction(s) known to produce the compound == | |
− | * | + | * [[RXN-2542]] |
− | == | + | == Reaction(s) of unknown directionality == |
== External links == | == External links == | ||
− | {{#set: | + | * PUBCHEM: |
− | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=71768102 71768102] |
− | {{#set: | + | * CHEBI: |
− | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=75921 75921] |
− | {{#set: | + | * METABOLIGHTS : MTBLC75921 |
− | {{#set: | + | * LIGAND-CPD: |
+ | ** [http://www.genome.jp/dbget-bin/www_bget?C15883 C15883] | ||
+ | {{#set: smiles=CC(CCCC(CCCC(C)CCCC(C)=CCC1(C=C(C(C)=C(C)C=1O)O))C)C}} | ||
+ | {{#set: inchi key=InChIKey=SUFZKUBNOVDJRR-WGEODTKDSA-N}} | ||
+ | {{#set: common name=2,3-dimethyl-6-phytyl-1,4-benzoquinol}} | ||
+ | {{#set: molecular weight=416.686 }} | ||
+ | {{#set: consumed by=RXN-2543}} | ||
+ | {{#set: produced by=RXN-2542}} |
Revision as of 14:52, 21 March 2018
Contents
Metabolite DMPBQ
- smiles:
- CC(CCCC(CCCC(C)CCCC(C)=CCC1(C=C(C(C)=C(C)C=1O)O))C)C
- inchi key:
- InChIKey=SUFZKUBNOVDJRR-WGEODTKDSA-N
- common name:
- 2,3-dimethyl-6-phytyl-1,4-benzoquinol
- molecular weight:
- 416.686
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links