Difference between revisions of "Ec-20 004180"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7117 CPD-7117] == * smiles: ** C(O)C1(C(O)C(O)C(O)C(O1)OC3(C(C2(C=C(O)C(O)=C(O)C=2))=[O+]C4...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-12583 RXN-12583] == * direction: ** LEFT-TO-RIGHT * common name: ** pyruvate:thiamin diphosphat...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7117 CPD-7117] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-12583 RXN-12583] ==
−
* smiles:
+
* direction:
−
** C(O)C1(C(O)C(O)C(O)C(O1)OC3(C(C2(C=C(O)C(O)=C(O)C=2))=[O+]C4(C(C=3)=C([O-])C=C([O-])C=4)))
+
** LEFT-TO-RIGHT
−
* inchi key:
+
−
** InChIKey=XENHPQQLDPAYIJ-PEVLUNPASA-M
+
 
* common name:
 
* common name:
−
** delphinidin-3-O-β-D-glucoside
+
** pyruvate:thiamin diphosphate acetaldehydetransferase (decarboxylating)
−
* molecular weight:
+
** Transketolase, C-terminal/Pyruvate-ferredoxin oxidoreductase, domain II
−
** 463.374   
+
 
* Synonym(s):
 
* Synonym(s):
−
** delfinidin-3-O-glucoside
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[RXN-8228]]
+
* With identifiers:
−
== Reaction(s) known to produce the compound ==
+
** 1 [[PYRUVATE]][c] '''+''' 1 [[THIAMINE-PYROPHOSPHATE]][c] '''+''' 1 [[PROTON]][c] '''=>''' 1 [[CARBON-DIOXIDE]][c] '''+''' 1 [[2-ALPHA-HYDROXYETHYL-THPP]][c]
−
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 1 pyruvate[c] '''+''' 1 thiamine diphosphate[c] '''+''' 1 H+[c] '''=>''' 1 CO2[c] '''+''' 1 2-(α-hydroxyethyl)thiamine diphosphate[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Ec-23_002710]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: EC-NUMBER
 +
** Source: [[orthology-aragem]]
 +
* Gene: [[Ec-27_000530]]
 +
** Source: [[orthology-aragem]]
 +
* Gene: [[Ec-18_003420]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: EC-NUMBER
 +
** Source: [[orthology-aragem]]
 +
== Pathways  ==
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-aragem]]
 +
*** Tool: [[pantograph]]
 +
* Category: [[annotation]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
−
* LIPID_MAPS : LMPK12010278
+
* LIGAND-RXN:
−
* PUBCHEM:
+
** [http://www.genome.jp/dbget-bin/www_bget?R00014 R00014]
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=165559 165559]
+
{{#set: direction=LEFT-TO-RIGHT}}
−
* CHEBI:
+
{{#set: common name=pyruvate:thiamin diphosphate acetaldehydetransferase (decarboxylating)}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=31463 31463]
+
{{#set: common name=Transketolase, C-terminal/Pyruvate-ferredoxin oxidoreductase, domain II}}
−
* LIGAND-CPD:
+
{{#set: gene associated=Ec-23_002710|Ec-27_000530|Ec-18_003420}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C12138 C12138]
+
{{#set: in pathway=}}
−
* HMDB : HMDB37997
+
{{#set: reconstruction category=orthology|annotation}}
−
{{#set: smiles=C(O)C1(C(O)C(O)C(O)C(O1)OC3(C(C2(C=C(O)C(O)=C(O)C=2))=[O+]C4(C(C=3)=C([O-])C=C([O-])C=4)))}}
+
{{#set: reconstruction source=annotation-esiliculosus_genome|orthology-aragem}}
−
{{#set: inchi key=InChIKey=XENHPQQLDPAYIJ-PEVLUNPASA-M}}
+
{{#set: reconstruction tool=pantograph|pathwaytools}}
−
{{#set: common name=delphinidin-3-O-β-D-glucoside}}
+
−
{{#set: molecular weight=463.374    }}
+
−
{{#set: common name=delfinidin-3-O-glucoside}}
+
−
{{#set: consumed by=RXN-8228}}
+

Revision as of 14:52, 21 March 2018

Reaction RXN-12583

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • pyruvate:thiamin diphosphate acetaldehydetransferase (decarboxylating)
    • Transketolase, C-terminal/Pyruvate-ferredoxin oxidoreductase, domain II
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

Reconstruction information

External links





Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Ec-20_004180&oldid=22327"